Difference between revisions of "CPD-18350"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ANDROST4ENE ANDROST4ENE] == * smiles: ** CC34(CCC(=O)C=C(CC[CH]1([CH](CCC2(C)(C(CC[CH]12)=O))3)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14220 RXN-14220] == * direction: ** LEFT-TO-RIGHT * common name: ** ORF * Synonym(s): == React...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ANDROST4ENE ANDROST4ENE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14220 RXN-14220] ==
* smiles:
+
* direction:
** CC34(CCC(=O)C=C(CC[CH]1([CH](CCC2(C)(C(CC[CH]12)=O))3))4)
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=AEMFNILZOJDQLW-QAGGRKNESA-N
+
 
* common name:
 
* common name:
** androst-4-ene-3,17-dione
+
** ORF
* molecular weight:
+
** 286.413   
+
 
* Synonym(s):
 
* Synonym(s):
** 4-androstene-3,17-dione
 
** androstenedione
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-12124]]
+
** 1 [[DUDP]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[DUMP]][c] '''+''' 1 [[Pi]][c] '''+''' 1 [[PROTON]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 dUDP[c] '''+''' 1 H2O[c] '''=>''' 1 dUMP[c] '''+''' 1 phosphate[c] '''+''' 1 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_12899]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_20236]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* DRUGBANK : DB01536
+
{{#set: direction=LEFT-TO-RIGHT}}
* NCI:
+
{{#set: common name=ORF}}
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=9563 9563]
+
{{#set: gene associated=Tiso_gene_12899|Tiso_gene_20236}}
* CAS : 63-05-8
+
{{#set: in pathway=}}
* LIPID_MAPS : LMST02020007
+
{{#set: reconstruction category=orthology|annotation}}
* PUBCHEM:
+
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation|orthology-esiliculosus}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6128 6128]
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
* HMDB : HMDB00053
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00280 C00280]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16422 16422]
+
* METABOLIGHTS : MTBLC16422
+
{{#set: smiles=CC34(CCC(=O)C=C(CC[CH]1([CH](CCC2(C)(C(CC[CH]12)=O))3))4)}}
+
{{#set: inchi key=InChIKey=AEMFNILZOJDQLW-QAGGRKNESA-N}}
+
{{#set: common name=androst-4-ene-3,17-dione}}
+
{{#set: molecular weight=286.413    }}
+
{{#set: common name=4-androstene-3,17-dione|androstenedione}}
+
{{#set: produced by=RXN-12124}}
+

Revision as of 14:59, 21 March 2018

Reaction RXN-14220

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ORF
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 dUDP[c] + 1 H2O[c] => 1 dUMP[c] + 1 phosphate[c] + 1 H+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links