Difference between revisions of "PWY-6352"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-591 CPD-591] == * smiles: ** C3(C(C1(C(=CC2(=C([O-])C=C(O)C=C([O+]=1)2))[O-]))=CC(O)=C(C=3)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8001 RXN-8001] == * direction: ** LEFT-TO-RIGHT * common name: ** histidinol_dehydrogenase * ec...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-591 CPD-591] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8001 RXN-8001] ==
−
* smiles:
+
* direction:
−
** C3(C(C1(C(=CC2(=C([O-])C=C(O)C=C([O+]=1)2))[O-]))=CC(O)=C(C=3)O)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=VEVZSMAEJFVWIL-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
−
** cyanidin
+
** histidinol_dehydrogenase
−
* molecular weight:
+
* ec number:
−
** 285.232   
+
** [http://enzyme.expasy.org/EC/1.1.1.23 EC-1.1.1.23]
 
* Synonym(s):
 
* Synonym(s):
−
** 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-1-Benzopyrylium
 
−
** 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromenylium
 
−
** 3,3',4',5,7-pentahydroxyflavylium
 
−
** cyanidol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-9725]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[WATER]][c] '''+''' 2 [[NAD]][c] '''+''' 1 [[HISTIDINOL]][c] '''=>''' 1 [[HIS]][c] '''+''' 2 [[NADH]][c] '''+''' 3 [[PROTON]][c]
−
* [[RXN-602]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 H2O[c] '''+''' 2 NAD+[c] '''+''' 1 histidinol[c] '''=>''' 1 L-histidine[c] '''+''' 2 NADH[c] '''+''' 3 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_11386]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
** Source: [[orthology-creinhardtii]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_7381]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[manual]]
 +
** Source: [[manual-primary_network]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202542 25202542]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=20641 20641]
−
* CHEBI:
+
* LIGAND-RXN:
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71682 71682]
+
** [http://www.genome.jp/dbget-bin/www_bget?R01158 R01158]
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05905 C05905]
+
{{#set: common name=histidinol_dehydrogenase}}
−
* HMDB : HMDB02708
+
{{#set: ec number=EC-1.1.1.23}}
−
{{#set: smiles=C3(C(C1(C(=CC2(=C([O-])C=C(O)C=C([O+]=1)2))[O-]))=CC(O)=C(C=3)O)}}
+
{{#set: gene associated=Tiso_gene_11386|Tiso_gene_7381}}
−
{{#set: inchi key=InChIKey=VEVZSMAEJFVWIL-UHFFFAOYSA-M}}
+
{{#set: in pathway=}}
−
{{#set: common name=cyanidin}}
+
{{#set: reconstruction category=orthology|manual|annotation}}
−
{{#set: molecular weight=285.232    }}
+
{{#set: reconstruction source=orthology-creinhardtii|annotation-in-silico_annotation|manual-primary_network|annotation-experimental_annotation|orthology-esiliculosus}}
−
{{#set: common name=2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-1-Benzopyrylium|2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromenylium|3,3',4',5,7-pentahydroxyflavylium|cyanidol}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: consumed by=RXN-9725}}
+
−
{{#set: produced by=RXN-602}}
+

Revision as of 15:00, 21 March 2018

Reaction RXN-8001

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • histidinol_dehydrogenase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 H2O[c] + 2 NAD+[c] + 1 histidinol[c] => 1 L-histidine[c] + 2 NADH[c] + 3 H+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-6352&oldid=31766"