Difference between revisions of "2-HYDROXYPHYTANOYL-COA"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_10324 == * left end position: ** 1194 * transcription direction: ** POSITIVE * right end position: ** 2763 * centisome position: ** 13.8290...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10139 CPD-10139] == * smiles: ** C=C(C1(CCC2(C(C1)O2)(C)))C * common name: ** (+)-(1S,4R)-l...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_10324 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10139 CPD-10139] ==
−
* left end position:
+
* smiles:
−
** 1194
+
** C=C(C1(CCC2(C(C1)O2)(C)))C
−
* transcription direction:
+
* common name:
−
** POSITIVE
+
** (+)-(1S,4R)-limonene-1,2- epoxide
−
* right end position:
+
* inchi key:
−
** 2763
+
** InChIKey=CCEFMUBVSUDRLG-MGRQHWMJSA-N
−
* centisome position:
+
* molecular weight:
−
** 13.829048    
+
** 152.236    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[3.4.21.92-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** experimental_annotation
+
== Reaction(s) of unknown directionality ==
−
***automated-name-match
+
* [[RXN-9464]]
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=1194}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12382524 12382524]
−
{{#set: right end position=2763}}
+
* HMDB : HMDB35158
−
{{#set: centisome position=13.829048   }}
+
* LIGAND-CPD:
−
{{#set: reaction associated=3.4.21.92-RXN}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C07271 C07271]
 +
{{#set: smiles=C=C(C1(CCC2(C(C1)O2)(C)))C}}
 +
{{#set: common name=(+)-(1S,4R)-limonene-1,2- epoxide}}
 +
{{#set: inchi key=InChIKey=CCEFMUBVSUDRLG-MGRQHWMJSA-N}}
 +
{{#set: molecular weight=152.236   }}
 +
{{#set: reversible reaction associated=RXN-9464}}

Revision as of 16:01, 21 March 2018

Metabolite CPD-10139

  • smiles:
    • C=C(C1(CCC2(C(C1)O2)(C)))C
  • common name:
    • (+)-(1S,4R)-limonene-1,2- epoxide
  • inchi key:
    • InChIKey=CCEFMUBVSUDRLG-MGRQHWMJSA-N
  • molecular weight:
    • 152.236
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=2-HYDROXYPHYTANOYL-COA&oldid=31861"