Difference between revisions of "Tiso gene 801"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14271 RXN-14271] == * direction: ** LEFT-TO-RIGHT * common name: ** (S)-3-hydroxypalmitoyl-CoA...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11752 CPD-11752] == * smiles: ** COC1(C(CO)OC(C(C1O)O)N7(C2(C(=CC=CC=2C6(C3(C(NC(C=3C5(C4(C...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11752 CPD-11752] == |
− | * | + | * smiles: |
− | ** | + | ** COC1(C(CO)OC(C(C1O)O)N7(C2(C(=CC=CC=2C6(C3(C(NC(C=3C5(C4(C=CC=C(C=4NC=5C=67)Cl)))=O)=O)))Cl))) |
* common name: | * common name: | ||
− | ** | + | ** rebeccamycin |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=QEHOIJJIZXRMAN-QZQSLCQPSA-N |
+ | * molecular weight: | ||
+ | ** 570.385 | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-10847]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * LIGAND-CPD: |
− | ** [http://www.ebi.ac.uk/ | + | ** [http://www.genome.jp/dbget-bin/www_bget?C19701 C19701] |
− | * | + | * CHEMSPIDER: |
− | ** [http:// | + | ** [http://www.chemspider.com/Chemical-Structure.65891.html 65891] |
− | {{#set: | + | * CHEBI: |
− | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=135511 135511] | |
− | + | * PUBCHEM: | |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=73110 73110] |
− | {{#set: | + | {{#set: smiles=COC1(C(CO)OC(C(C1O)O)N7(C2(C(=CC=CC=2C6(C3(C(NC(C=3C5(C4(C=CC=C(C=4NC=5C=67)Cl)))=O)=O)))Cl)))}} |
− | {{#set: | + | {{#set: common name=rebeccamycin}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=QEHOIJJIZXRMAN-QZQSLCQPSA-N}} |
− | + | {{#set: molecular weight=570.385 }} | |
+ | {{#set: produced by=RXN-10847}} |
Revision as of 16:01, 21 March 2018
Contents
Metabolite CPD-11752
- smiles:
- COC1(C(CO)OC(C(C1O)O)N7(C2(C(=CC=CC=2C6(C3(C(NC(C=3C5(C4(C=CC=C(C=4NC=5C=67)Cl)))=O)=O)))Cl)))
- common name:
- rebeccamycin
- inchi key:
- InChIKey=QEHOIJJIZXRMAN-QZQSLCQPSA-N
- molecular weight:
- 570.385
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links