Difference between revisions of "RXN0-2144"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17050 CPD-17050] == * smiles: ** C(O)C23(SSC(CC1(=CC=CC=C1))(NC(=O)2)C(=O)N3) * inchi key:...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-2144 RXN0-2144] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-hydroxyacyl-[acyl-carrier...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-2144 RXN0-2144] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** 3- | + | ** 3-hydroxyacyl-[acyl-carrier-protein] dehydratase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/4.2.1.59 EC-4.2.1.59] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[b-Hydroxy-cis-D5-dodecenoyl-ACPs]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[Trans-D3-cis-D5-dodecenoyl-ACPs]][c] |
− | == | + | * With common name(s): |
+ | ** 1 a (3R,5Z)-3-hydroxy-dodec-5-enoyl-[acp][c] '''=>''' 1 H2O[c] '''+''' 1 a (3E,5Z)-dodeca-3,5-dienoyl-[acp][c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_6884]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | * [[PWY0-862]], (5Z)-dodec-5-enoate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-862 PWY0-862] | ||
+ | ** '''5''' reactions found over '''6''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=3-hydroxyacyl-[acyl-carrier-protein] dehydratase}} | |
− | {{#set: | + | {{#set: ec number=EC-4.2.1.59}} |
− | {{#set: | + | {{#set: gene associated=Tiso_gene_6884}} |
− | {{#set: | + | {{#set: in pathway=PWY0-862}} |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-experimental_annotation}} |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
Revision as of 16:01, 21 March 2018
Contents
Reaction RXN0-2144
- direction:
- LEFT-TO-RIGHT
- common name:
- 3-hydroxyacyl-[acyl-carrier-protein] dehydratase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 b-Hydroxy-cis-D5-dodecenoyl-ACPs[c] => 1 WATER[c] + 1 Trans-D3-cis-D5-dodecenoyl-ACPs[c]
- With common name(s):
- 1 a (3R,5Z)-3-hydroxy-dodec-5-enoyl-[acp][c] => 1 H2O[c] + 1 a (3E,5Z)-dodeca-3,5-dienoyl-[acp][c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_6884
- Source: annotation-experimental_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-experimental_annotation
Pathways
- PWY0-862, (5Z)-dodec-5-enoate biosynthesis: PWY0-862
- 5 reactions found over 6 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
External links
"3-hydroxyacyl-[acyl-carrier-protein] dehydratase" cannot be used as a page name in this wiki.