Difference between revisions of "2.1.1.137-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PARATHION PARATHION] == * smiles: ** CCOP(OC1(C=CC(=CC=1)[N+](=O)[O-]))(OCC)=S * inchi key: **...")
(Created page with "Category:Gene == Gene Tiso_gene_5584 == * Synonym(s): == Reactions associated == * Reaction: 2.7.10.1-RXN ** Source: orthology-esiliculosus * Reaction: 3.6.4.4-...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PARATHION PARATHION] ==
+
== Gene Tiso_gene_5584 ==
* smiles:
+
** CCOP(OC1(C=CC(=CC=1)[N+](=O)[O-]))(OCC)=S
+
* inchi key:
+
** InChIKey=LCCNCVORNKJIRZ-UHFFFAOYSA-N
+
* common name:
+
** parathion
+
* molecular weight:
+
** 291.258   
+
 
* Synonym(s):
 
* Synonym(s):
** ethyl parathion
 
** parthion
 
** alkron
 
** Paraphos
 
** Foliclal
 
** Fosferno
 
** Fostox
 
** Rhodiatox
 
** O,O-diethyl O-p-nitrophenyl phosphorothioate
 
** diethyl-p-nitrophenyl monothiophosphate
 
** DNTP
 
** Alleron
 
** Aphamite
 
** Etilon
 
** Folidol
 
** Phoskil
 
** Parathion-E
 
** Aqua 9-Parathion
 
** Bladen
 
** phosphorothioic acid O,O-diethyl-O-(4-nitrophenyl) ester
 
** diethyl p-nitrophenyl thiophosphate
 
** O,O-diethyl-O-(p-nitrophenyl)thionophosphate
 
** diethylparathion
 
** p-nitrophenol O-ester with O,O-diethylphosphorothioate
 
** AATP
 
** acc 3422
 
** american cyanamid 3422
 
** Aralo
 
** bayer e-605
 
** bladan f
 
** corothion
 
** corthione
 
** danthion
 
** ecatox
 
** fosfive
 
** fosova
 
** fostern
 
** genithion
 
** kolphos
 
** kypthion
 
** lirothion
 
** murfos
 
** nitrostygmine
 
** niuif-100
 
** nourithion
 
** oleofos 20
 
** oleoparathion
 
** Orthophos
 
** panthion
 
** Paramar
 
** paramar 50
 
** parathene
 
** Parawet
 
** pestox plus
 
** pethion
 
** phosphemol
 
** phosphenol
 
** phosphostigmine
 
** stathion
 
** strathion
 
** sulfos
 
** thiophos 3422
 
** vapophos
 
** diethyl para-nitrophenol thiophosphate
 
** diethyl 4-nitrophenyl phosphorothionate
 
** diethyl p-nitrophenyl thionophosphate
 
** drexel parathion 8E
 
** E 605 F
 
** e 605 forte
 
** ekatox
 
** ethlon
 
** folidol e605
 
** folidol oil
 
** fosfermo
 
** fosfex
 
** gearphos
 
** lethalaire g-54
 
** oleoparaphene
 
** Paradust
 
** rhodiasol
 
** rhodiatrox
 
** selephos
 
** soprathion
 
** super rodiatox
 
** vitrex
 
** penncap e
 
** thiomex
 
** tiofos
 
** Viran
 
** Durathion
 
** Thionspray No.84
 
** Bladan
 
** Diethyl O-p-nitrophenyl phosphorothioate
 
** Fosferno 50
 
** Niran
 
** Ethyl parathion (O,O-diethyl-O-p-nitrophenylthiophosphate)
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[ARYLDIALKYL-PHOSPHATASE-RXN]]
+
* Reaction: [[2.7.10.1-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-esiliculosus]]
== Reaction(s) of unknown directionality ==
+
* Reaction: [[3.6.4.4-RXN]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[PROTEIN-KINASE-RXN]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* CAS : 56-38-2
+
{{#set: reaction associated=2.7.10.1-RXN|3.6.4.4-RXN|PROTEIN-KINASE-RXN}}
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=991 991]
+
* HMDB : HMDB01355
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C06604 C06604]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.13844817.html 13844817]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27928 27928]
+
{{#set: smiles=CCOP(OC1(C=CC(=CC=1)[N+](=O)[O-]))(OCC)=S}}
+
{{#set: inchi key=InChIKey=LCCNCVORNKJIRZ-UHFFFAOYSA-N}}
+
{{#set: common name=parathion}}
+
{{#set: molecular weight=291.258    }}
+
{{#set: common name=ethyl parathion|parthion|alkron|Paraphos|Foliclal|Fosferno|Fostox|Rhodiatox|O,O-diethyl O-p-nitrophenyl phosphorothioate|diethyl-p-nitrophenyl monothiophosphate|DNTP|Alleron|Aphamite|Etilon|Folidol|Phoskil|Parathion-E|Aqua 9-Parathion|Bladen|phosphorothioic acid O,O-diethyl-O-(4-nitrophenyl) ester|diethyl p-nitrophenyl thiophosphate|O,O-diethyl-O-(p-nitrophenyl)thionophosphate|diethylparathion|p-nitrophenol O-ester with O,O-diethylphosphorothioate|AATP|acc 3422|american cyanamid 3422|Aralo|bayer e-605|bladan f|corothion|corthione|danthion|ecatox|fosfive|fosova|fostern|genithion|kolphos|kypthion|lirothion|murfos|nitrostygmine|niuif-100|nourithion|oleofos 20|oleoparathion|Orthophos|panthion|Paramar|paramar 50|parathene|Parawet|pestox plus|pethion|phosphemol|phosphenol|phosphostigmine|stathion|strathion|sulfos|thiophos 3422|vapophos|diethyl para-nitrophenol thiophosphate|diethyl 4-nitrophenyl phosphorothionate|diethyl p-nitrophenyl thionophosphate|drexel parathion 8E|E 605 F|e 605 forte|ekatox|ethlon|folidol e605|folidol oil|fosfermo|fosfex|gearphos|lethalaire g-54|oleoparaphene|Paradust|rhodiasol|rhodiatrox|selephos|soprathion|super rodiatox|vitrex|penncap e|thiomex|tiofos|Viran|Durathion|Thionspray No.84|Bladan|Diethyl O-p-nitrophenyl phosphorothioate|Fosferno 50|Niran|Ethyl parathion (O,O-diethyl-O-p-nitrophenylthiophosphate)}}
+
{{#set: consumed by=ARYLDIALKYL-PHOSPHATASE-RXN}}
+

Revision as of 15:02, 21 March 2018

Gene Tiso_gene_5584

  • Synonym(s):

Reactions associated

Pathways associated

External links