Difference between revisions of "AMINO-RIBOSYLAMINO-1H-3H-PYR-DIONE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11770 CPD-11770] == * smiles: ** C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)CO)=2)) * inchi key: ** I...") |
(Created page with "Category:Gene == Gene Tiso_gene_16652 == * Synonym(s): == Reactions associated == * Reaction: 1.4.3.19-RXN ** Source: orthology-synechocystis == Pathways associat...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_16652 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[1.4.3.19-RXN]] | |
− | == | + | ** Source: [[orthology-synechocystis]] |
− | * [[ | + | == Pathways associated == |
+ | * [[PWY-7396]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=1.4.3.19-RXN}} | |
− | + | {{#set: pathway associated=PWY-7396}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + |
Revision as of 15:02, 21 March 2018
Gene Tiso_gene_16652
- Synonym(s):
Reactions associated
- Reaction: 1.4.3.19-RXN
- Source: orthology-synechocystis