Difference between revisions of "PWY-6123"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7367 CPD-7367] == * smiles: ** [CH](=O)C1(=CC=C(O)C(N)=C1) * inchi key: ** InChIKey=LMGGPKY...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MG+2 MG+2] == * smiles: ** [Mg++] * common name: ** Mg2+ * inchi key: ** InChIKey=JLVVSXFLKOJNI...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MG+2 MG+2] == |
* smiles: | * smiles: | ||
− | ** [ | + | ** [Mg++] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Mg2+ |
+ | * inchi key: | ||
+ | ** InChIKey=JLVVSXFLKOJNIY-UHFFFAOYSA-N | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 24.305 |
* Synonym(s): | * Synonym(s): | ||
+ | ** magnesium | ||
+ | ** Mg+2 | ||
+ | ** Mg++ | ||
+ | ** magnesium ion | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN1F-20]] | ||
+ | * [[TransportSeed_MG+2]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[TransportSeed_MG+2]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[ | + | * [[ExchangeSeed_MG+2]] |
== External links == | == External links == | ||
+ | * DRUGBANK : DB01378 | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=888 888] |
+ | * HMDB : HMDB00547 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00305 C00305] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.865.html 865] | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18420 18420] |
− | {{#set: smiles=[ | + | * BIGG : mg2 |
− | {{#set: inchi key=InChIKey= | + | {{#set: smiles=[Mg++]}} |
− | {{#set: common name= | + | {{#set: common name=Mg2+}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=JLVVSXFLKOJNIY-UHFFFAOYSA-N}} |
− | {{#set: reversible reaction associated= | + | {{#set: molecular weight=24.305 }} |
+ | {{#set: common name=magnesium|Mg+2|Mg++|magnesium ion}} | ||
+ | {{#set: consumed by=RXN1F-20|TransportSeed_MG+2}} | ||
+ | {{#set: produced by=TransportSeed_MG+2}} | ||
+ | {{#set: reversible reaction associated=ExchangeSeed_MG+2}} |
Revision as of 16:05, 21 March 2018
Contents
Metabolite MG+2
- smiles:
- [Mg++]
- common name:
- Mg2+
- inchi key:
- InChIKey=JLVVSXFLKOJNIY-UHFFFAOYSA-N
- molecular weight:
- 24.305
- Synonym(s):
- magnesium
- Mg+2
- Mg++
- magnesium ion
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- DRUGBANK : DB01378
- PUBCHEM:
- HMDB : HMDB00547
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : mg2