Difference between revisions of "RXN-16659"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Deoxyhypusine-Synthase-Lysine Deoxyhypusine-Synthase-Lysine] == * common name: ** a [deoxyhypus...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14873 CPD-14873] == * smiles: ** C(=O)([O-])C1(C=C(N)C(O)=CC=1) * common name: ** 3-amino-4...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14873 CPD-14873] == |
| + | * smiles: | ||
| + | ** C(=O)([O-])C1(C=C(N)C(O)=CC=1) | ||
* common name: | * common name: | ||
| − | ** | + | ** 3-amino-4-hydroxybenzoate |
| + | * inchi key: | ||
| + | ** InChIKey=MRBKRZAPGUCWOS-UHFFFAOYSA-M | ||
| + | * molecular weight: | ||
| + | ** 152.129 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 3-amino-4-hydroxybenzoic acid | ||
| + | ** 3,4-AHBA | ||
| + | ** 5-amino saliciylic acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-13870]] | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54694272 54694272] |
| − | {{#set: | + | * CHEMSPIDER: |
| + | ** [http://www.chemspider.com/Chemical-Structure.58593.html 58593] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60005 60005] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C12115 C12115] | ||
| + | {{#set: smiles=C(=O)([O-])C1(C=C(N)C(O)=CC=1)}} | ||
| + | {{#set: common name=3-amino-4-hydroxybenzoate}} | ||
| + | {{#set: inchi key=InChIKey=MRBKRZAPGUCWOS-UHFFFAOYSA-M}} | ||
| + | {{#set: molecular weight=152.129 }} | ||
| + | {{#set: common name=3-amino-4-hydroxybenzoic acid|3,4-AHBA|5-amino saliciylic acid}} | ||
| + | {{#set: reversible reaction associated=RXN-13870}} | ||
Revision as of 15:05, 21 March 2018
Contents
Metabolite CPD-14873
- smiles:
- C(=O)([O-])C1(C=C(N)C(O)=CC=1)
- common name:
- 3-amino-4-hydroxybenzoate
- inchi key:
- InChIKey=MRBKRZAPGUCWOS-UHFFFAOYSA-M
- molecular weight:
- 152.129
- Synonym(s):
- 3-amino-4-hydroxybenzoic acid
- 3,4-AHBA
- 5-amino saliciylic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=O)([O-])C1(C=C(N)C(O)=CC=1)" cannot be used as a page name in this wiki.
