Difference between revisions of "Tiso gene 18707"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11524 CPD-11524] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)C...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5033 PWY-5033] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-12...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11524 CPD-11524] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5033 PWY-5033] ==
−
* smiles:
+
* taxonomic range:
−
** CCC=CCC4(C(=O)CCC(CCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-1239]
−
* inchi key:
+
−
** InChIKey=ADGIRVMSHGGGHU-JYNUABGASA-J
+
 
* common name:
 
* common name:
−
** OPC6-3-ketoacyl-CoA
+
** nicotinate degradation II
−
* molecular weight:
+
−
** 1025.85   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-10700]]
+
'''1''' reactions found over '''5''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[RXN-646]]
−
* [[RXN-10702]]
+
** 1 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_14341]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=MALEATE-ISOMERASE-RXN MALEATE-ISOMERASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11353 RXN-11353]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7585 RXN-7585]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7586 RXN-7586]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-1239}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237277 44237277]
+
{{#set: common name=nicotinate degradation II}}
−
{{#set: smiles=CCC=CCC4(C(=O)CCC(CCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)}}
+
{{#set: reaction found=1}}
−
{{#set: inchi key=InChIKey=ADGIRVMSHGGGHU-JYNUABGASA-J}}
+
{{#set: total reaction=5}}
−
{{#set: common name=OPC6-3-ketoacyl-CoA}}
+
{{#set: completion rate=20.0}}
−
{{#set: molecular weight=1025.85    }}
+
−
{{#set: consumed by=RXN-10700}}
+
−
{{#set: produced by=RXN-10702}}
+

Revision as of 16:07, 21 March 2018

Pathway PWY-5033

  • taxonomic range:
  • common name:
    • nicotinate degradation II
  • Synonym(s):

Reaction(s) found

1 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_18707&oldid=32503"