Difference between revisions of "D-GALACTOSYL-14-D-GALACTOSYL-14-D-"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GDR_nadp_h GDR_nadp_h] == * direction: ** LEFT-TO-RIGHT * common name: ** glutathione-disulfide red...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11524 CPD-11524] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)C...")
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GDR_nadp_h GDR_nadp_h] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11524 CPD-11524] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CCC=CCC4(C(=O)CCC(CCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
 
* common name:
 
* common name:
** glutathione-disulfide reductase (NADP), chloroplast
+
** OPC6-3-ketoacyl-CoA
 +
* inchi key:
 +
** InChIKey=ADGIRVMSHGGGHU-JYNUABGASA-J
 +
* molecular weight:
 +
** 1025.85   
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-10700]]
** 1.0 [[PROTON]][h] '''+''' 1.0 [[OXIDIZED-GLUTATHIONE]][h] '''+''' 1.0 [[NADPH]][h] '''=>''' 1.0 [[NADP]][h] '''+''' 2.0 [[GLUTATHIONE]][h]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
* [[RXN-10702]]
** 1.0 H+[h] '''+''' 1.0 glutathione disulfide[h] '''+''' 1.0 NADPH[h] '''=>''' 1.0 NADP+[h] '''+''' 2.0 glutathione[h]
+
== Reaction(s) of unknown directionality ==
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Tiso_gene_2804]]
+
** [[pantograph]]-[[creinhardtii]]
+
* [[Tiso_gene_12533]]
+
** [[pantograph]]-[[creinhardtii]]
+
== Pathways  ==
+
== Reconstruction information  ==
+
* Category: [[orthology]]
+
** Source: [[orthology-creinhardtii]]
+
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: common name=glutathione-disulfide reductase (NADP), chloroplast}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237277 44237277]
{{#set: gene associated=Tiso_gene_2804|Tiso_gene_12533}}
+
{{#set: smiles=CCC=CCC4(C(=O)CCC(CCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)}}
{{#set: in pathway=}}
+
{{#set: common name=OPC6-3-ketoacyl-CoA}}
{{#set: reconstruction category=orthology}}
+
{{#set: inchi key=InChIKey=ADGIRVMSHGGGHU-JYNUABGASA-J}}
{{#set: reconstruction source=orthology-creinhardtii}}
+
{{#set: molecular weight=1025.85    }}
{{#set: reconstruction tool=pantograph}}
+
{{#set: consumed by=RXN-10700}}
 +
{{#set: produced by=RXN-10702}}

Revision as of 16:08, 21 March 2018

Metabolite CPD-11524

  • smiles:
    • CCC=CCC4(C(=O)CCC(CCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
  • common name:
    • OPC6-3-ketoacyl-CoA
  • inchi key:
    • InChIKey=ADGIRVMSHGGGHU-JYNUABGASA-J
  • molecular weight:
    • 1025.85
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCC=CCC4(C(=O)CCC(CCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)" cannot be used as a page name in this wiki.