Difference between revisions of "Tiso gene 2572"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-DEHYDROPANTOATE 2-DEHYDROPANTOATE] == * smiles: ** CC(C(=O)C([O-])=O)(CO)C * inchi key: ** In...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PGIA PGIA] == * direction: ** REVERSIBLE * common name: ** glucose-6-phosphate isomerase (g6p-A) *...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-DEHYDROPANTOATE 2-DEHYDROPANTOATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=PGIA PGIA] ==
−
* smiles:
+
* direction:
−
** CC(C(=O)C([O-])=O)(CO)C
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=PKVVTUWHANFMQC-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
−
** 2-dehydropantoate
+
** glucose-6-phosphate isomerase (g6p-A)
−
* molecular weight:
+
−
** 145.135   
+
 
* Synonym(s):
 
* Synonym(s):
−
** ketopantoate
 
−
** 2-ketopantoate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[2-DEHYDROPANTOATE-REDUCT-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[ALPHA-GLC-6-P]][c] '''<=>''' 1.0 [[FRUCTOSE-6P]][c]
−
* [[MTMOHT]]
+
* With common name(s):
−
* [[RXN-15635]]
+
** 1.0 &alpha;-D-glucose 6-phosphate[c] '''<=>''' 1.0 &beta;-D-fructofuranose 6-phosphate[c]
−
* [[R01226]]
+
 
−
== Reaction(s) of unknown directionality ==
+
== Genes associated with this reaction  ==
−
* [[3-CH3-2-OXOBUTANOATE-OH-CH3-XFER-RXN]]
+
Genes have been associated with this reaction based on different elements listed below.
−
* [[KETOPANTOALDOLASE-RXN]]
+
* Gene: [[Tiso_gene_19480]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* DRUGBANK : DB03795
+
{{#set: direction=REVERSIBLE}}
−
* PUBCHEM:
+
{{#set: common name=glucose-6-phosphate isomerase (g6p-A)}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16755619 16755619]
+
{{#set: gene associated=Tiso_gene_19480}}
−
* LIGAND-CPD:
+
{{#set: in pathway=}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00966 C00966]
+
{{#set: reconstruction category=orthology}}
−
* CHEMSPIDER:
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
** [http://www.chemspider.com/Chemical-Structure.14649571.html 14649571]
+
{{#set: reconstruction tool=pantograph}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=11561 11561]
+
−
* BIGG : 2dhp
+
−
{{#set: smiles=CC(C(=O)C([O-])=O)(CO)C}}
+
−
{{#set: inchi key=InChIKey=PKVVTUWHANFMQC-UHFFFAOYSA-M}}
+
−
{{#set: common name=2-dehydropantoate}}
+
−
{{#set: molecular weight=145.135    }}
+
−
{{#set: common name=ketopantoate|2-ketopantoate}}
+
−
{{#set: consumed by=2-DEHYDROPANTOATE-REDUCT-RXN}}
+
−
{{#set: produced by=MTMOHT|RXN-15635|R01226}}
+
−
{{#set: reversible reaction associated=3-CH3-2-OXOBUTANOATE-OH-CH3-XFER-RXN|KETOPANTOALDOLASE-RXN}}
+

Revision as of 15:10, 21 March 2018

Reaction PGIA

  • direction:
    • REVERSIBLE
  • common name:
    • glucose-6-phosphate isomerase (g6p-A)
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 α-D-glucose 6-phosphate[c] <=> 1.0 β-D-fructofuranose 6-phosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_2572&oldid=32720"