Difference between revisions of "Tiso gene 20348"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6731 PWY-6731] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-712 CPD-712] == * smiles: ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6731 PWY-6731] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-712 CPD-712] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
+
** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
 
* common name:
 
* common name:
−
** starch degradation III
+
** 6-deoxocathasterone
 +
* inchi key:
 +
** InChIKey=ZHZKWZJLUNXOSN-YUZBOUAZSA-N
 +
* molecular weight:
 +
** 418.702   
 
* Synonym(s):
 
* Synonym(s):
 +
** deoxocathasterone
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''2''' reactions found over '''4''' reactions in the full pathway
+
* [[RXN-774]]
−
* [[PHOSPHOGLUCMUT-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** 2 associated gene(s):
+
* [[RXN-773]]
−
*** [[Tiso_gene_13477]]
+
== Reaction(s) of unknown directionality ==
−
*** [[Tiso_gene_4816]]
+
−
** 3 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[manual-primary_network]]
+
−
*** [[annotation-experimental_annotation]]
+
−
* [[RXN-12171]]
+
−
** 1 associated gene(s):
+
−
*** [[Tiso_gene_1011]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
== Reaction(s) not found ==
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=CYCLOMALTODEXTRINASE-RXN CYCLOMALTODEXTRINASE-RXN]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12181 RXN-12181]
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-2157}}
+
* LIPID_MAPS : LMST01030124
−
{{#set: common name=starch degradation III}}
+
* PUBCHEM:
−
{{#set: reaction found=2}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16061344 16061344]
−
{{#set: total reaction=4}}
+
* CHEBI:
−
{{#set: completion rate=50.0}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=20714 20714]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C15798 C15798]
 +
{{#set: smiles=CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
 +
{{#set: common name=6-deoxocathasterone}}
 +
{{#set: inchi key=InChIKey=ZHZKWZJLUNXOSN-YUZBOUAZSA-N}}
 +
{{#set: molecular weight=418.702    }}
 +
{{#set: common name=deoxocathasterone}}
 +
{{#set: consumed by=RXN-774}}
 +
{{#set: produced by=RXN-773}}

Revision as of 16:10, 21 March 2018

Metabolite CPD-712

  • smiles:
    • CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • common name:
    • 6-deoxocathasterone
  • inchi key:
    • InChIKey=ZHZKWZJLUNXOSN-YUZBOUAZSA-N
  • molecular weight:
    • 418.702
  • Synonym(s):
    • deoxocathasterone

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_20348&oldid=32739"