Difference between revisions of "CPD-6991"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_7631 == * left end position: ** 47 * transcription direction: ** POSITIVE * right end position: ** 5450 * centisome position: ** 0.42883214...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8259 CPD-8259] == * smiles: ** C(O)C1(C(O)C(O)C(O1)[N+]2(C=CC=C(C(=O)[O-])C=2)) * common na...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8259 CPD-8259] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(O)C1(C(O)C(O)C(O1)[N+]2(C=CC=C(C(=O)[O-])C=2)) |
| − | * | + | * common name: |
| − | ** | + | ** β-D-ribosylnicotinate |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=PUEDDPCUCPRQNY-ZYUZMQFOSA-N |
| − | * | + | * molecular weight: |
| − | ** | + | ** 255.227 |
* Synonym(s): | * Synonym(s): | ||
| + | ** nicotinic acid riboside | ||
| + | ** ribosylnicotinate | ||
| + | ** nicotinic acid ribose | ||
| + | ** nicotinate riboside | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-8443]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[RXN-14227]] |
| − | == | + | == Reaction(s) of unknown directionality == |
| + | * [[NRPH]] | ||
== External links == | == External links == | ||
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05841 C05841] |
| − | {{#set: | + | * HMDB : HMDB06809 |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58527 58527] |
| + | * METABOLIGHTS : MTBLC58527 | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=161233 161233] | ||
| + | {{#set: smiles=C(O)C1(C(O)C(O)C(O1)[N+]2(C=CC=C(C(=O)[O-])C=2))}} | ||
| + | {{#set: common name=β-D-ribosylnicotinate}} | ||
| + | {{#set: inchi key=InChIKey=PUEDDPCUCPRQNY-ZYUZMQFOSA-N}} | ||
| + | {{#set: molecular weight=255.227 }} | ||
| + | {{#set: common name=nicotinic acid riboside|ribosylnicotinate|nicotinic acid ribose|nicotinate riboside}} | ||
| + | {{#set: consumed by=RXN-8443}} | ||
| + | {{#set: produced by=RXN-14227}} | ||
| + | {{#set: reversible reaction associated=NRPH}} | ||
Revision as of 15:11, 21 March 2018
Contents
Metabolite CPD-8259
- smiles:
- C(O)C1(C(O)C(O)C(O1)[N+]2(C=CC=C(C(=O)[O-])C=2))
- common name:
- β-D-ribosylnicotinate
- inchi key:
- InChIKey=PUEDDPCUCPRQNY-ZYUZMQFOSA-N
- molecular weight:
- 255.227
- Synonym(s):
- nicotinic acid riboside
- ribosylnicotinate
- nicotinic acid ribose
- nicotinate riboside
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C1(C(O)C(O)C(O1)[N+]2(C=CC=C(C(=O)[O-])C=2))" cannot be used as a page name in this wiki.
