Difference between revisions of "ExchangeSeed CU+2"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5885 PWY-5885] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THF THF] == * smiles: ** C(NC1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))[CH]3(CNC2(=C(C(=O)NC(...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THF THF] == |
− | * | + | * smiles: |
− | ** [ | + | ** C(NC1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))[CH]3(CNC2(=C(C(=O)NC(N)=N2)N3)) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** tetrahydropteroyl mono-L-glutamate |
+ | * inchi key: | ||
+ | ** InChIKey=MSTNYGQPCMXVAQ-RYUDHWBXSA-L | ||
+ | * molecular weight: | ||
+ | ** 443.418 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** H4PteGlu |
− | ** | + | ** 5,6,7,8-tetrahydrofolic acid |
+ | ** tetrahydrofolic acid | ||
+ | ** (6S)-tetrahydrofolate | ||
+ | ** H4PteGlu1 | ||
+ | ** tetrahydrofolate | ||
+ | ** tetrahydrafolate | ||
+ | ** 5,6,7,8-tetrahydrofolate | ||
+ | ** THF | ||
+ | ** tetra-H-folate | ||
+ | ** th-folate | ||
+ | ** FH4 | ||
+ | ** folate-H4 | ||
+ | ** tetrahydropteroylglutamate | ||
+ | ** H4F | ||
+ | ** vitamin B9 | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[FTHFL]] | |
− | * [[ | + | * [[FGFTm]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[MTMOHT]] | |
− | + | * [[R00946]] | |
− | + | * [[FTHFO]] | |
− | + | * [[R00939]] | |
− | + | * [[R01226]] | |
− | + | * [[R04560]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[FPGFTm]] | |
− | + | * [[THFtm]] | |
− | + | * [[FPAIF]] | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 135-16-0 |
− | {{#set: | + | * CAS : 29347-89-5 |
− | {{#set: | + | * BIGG : thf |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25790919 25790919] |
− | {{#set: | + | * HMDB : HMDB01846 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00101 C00101] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57453 57453] | ||
+ | * METABOLIGHTS : MTBLC57453 | ||
+ | {{#set: smiles=C(NC1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))[CH]3(CNC2(=C(C(=O)NC(N)=N2)N3))}} | ||
+ | {{#set: common name=tetrahydropteroyl mono-L-glutamate}} | ||
+ | {{#set: inchi key=InChIKey=MSTNYGQPCMXVAQ-RYUDHWBXSA-L}} | ||
+ | {{#set: molecular weight=443.418 }} | ||
+ | {{#set: common name=H4PteGlu|5,6,7,8-tetrahydrofolic acid|tetrahydrofolic acid|(6S)-tetrahydrofolate|H4PteGlu1|tetrahydrofolate|tetrahydrafolate|5,6,7,8-tetrahydrofolate|THF|tetra-H-folate|th-folate|FH4|folate-H4|tetrahydropteroylglutamate|H4F|vitamin B9}} | ||
+ | {{#set: consumed by=FTHFL|FGFTm}} | ||
+ | {{#set: produced by=MTMOHT|R00946|FTHFO|R00939|R01226|R04560}} | ||
+ | {{#set: reversible reaction associated=FPGFTm|THFtm|FPAIF}} |
Revision as of 15:12, 21 March 2018
Contents
Metabolite THF
- smiles:
- C(NC1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))[CH]3(CNC2(=C(C(=O)NC(N)=N2)N3))
- common name:
- tetrahydropteroyl mono-L-glutamate
- inchi key:
- InChIKey=MSTNYGQPCMXVAQ-RYUDHWBXSA-L
- molecular weight:
- 443.418
- Synonym(s):
- H4PteGlu
- 5,6,7,8-tetrahydrofolic acid
- tetrahydrofolic acid
- (6S)-tetrahydrofolate
- H4PteGlu1
- tetrahydrofolate
- tetrahydrafolate
- 5,6,7,8-tetrahydrofolate
- THF
- tetra-H-folate
- th-folate
- FH4
- folate-H4
- tetrahydropteroylglutamate
- H4F
- vitamin B9
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 135-16-0
- CAS : 29347-89-5
- BIGG : thf
- PUBCHEM:
- HMDB : HMDB01846
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC57453
"C(NC1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))[CH]3(CNC2(=C(C(=O)NC(N)=N2)N3))" cannot be used as a page name in this wiki.