Difference between revisions of "PYRUVDEH-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10055 CPD-10055] == * smiles: ** C=C(C1(CC(C(CC1)(O)C)O))C * inchi key: ** InChIKey=WKZWTZT...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14775 RXN-14775] == * direction: ** LEFT-TO-RIGHT * common name: ** acyl-coenzyme_a_oxidase * e...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14775 RXN-14775] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** acyl-coenzyme_a_oxidase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.3.3.6 EC-1.3.3.6] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[CPD-15668]][c] '''=>''' 1 [[HYDROGEN-PEROXIDE]][c] '''+''' 1 [[CPD-15654]][c] |
− | == | + | * With common name(s): |
+ | ** 1 oxygen[c] '''+''' 1 4-cis-undecenoyl-CoA[c] '''=>''' 1 hydrogen peroxide[c] '''+''' 1 2-trans, 4-cis-undecadienoyl-CoA[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_18566]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | * [[PWY-7337]], 10-cis-heptadecenoyl-CoA degradation (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7337 PWY-7337] | ||
+ | ** '''3''' reactions found over '''12''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=acyl-coenzyme_a_oxidase}} | |
− | + | {{#set: ec number=EC-1.3.3.6}} | |
− | + | {{#set: gene associated=Tiso_gene_18566}} | |
− | + | {{#set: in pathway=PWY-7337}} | |
− | + | {{#set: reconstruction category=orthology|annotation}} | |
− | + | {{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}} | |
− | + | {{#set: reconstruction tool=pantograph|pathwaytools}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 16:12, 21 March 2018
Contents
Reaction RXN-14775
- direction:
- LEFT-TO-RIGHT
- common name:
- acyl-coenzyme_a_oxidase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 OXYGEN-MOLECULE[c] + 1 CPD-15668[c] => 1 HYDROGEN-PEROXIDE[c] + 1 CPD-15654[c]
- With common name(s):
- 1 oxygen[c] + 1 4-cis-undecenoyl-CoA[c] => 1 hydrogen peroxide[c] + 1 2-trans, 4-cis-undecadienoyl-CoA[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_18566
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
Pathways
- PWY-7337, 10-cis-heptadecenoyl-CoA degradation (yeast): PWY-7337
- 3 reactions found over 12 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation