Difference between revisions of "RXN-16649"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-667 CPD-667] == * smiles: ** CC(OCCC(C([O-])=O)[N+])=O * inchi key: ** InChIKey=FCXZBWSIAGG...") |
(Created page with "Category:Gene == Gene Tiso_gene_7025 == * right end position: ** 10277 * transcription direction: ** NEGATIVE * left end position: ** 9076 * centisome position: ** 78.1403...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_7025 == |
− | * | + | * right end position: |
− | ** | + | ** 10277 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 9076 |
− | * | + | * centisome position: |
− | ** | + | ** 78.140335 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[DNA-DIRECTED-DNA-POLYMERASE-RXN]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | + | *** Assignment: ec-number | |
− | + | * Reaction: [[RXN0-4961]] | |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: automated-name-match |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=10277}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=9076}} | |
− | + | {{#set: centisome position=78.140335 }} | |
− | + | {{#set: reaction associated=DNA-DIRECTED-DNA-POLYMERASE-RXN|RXN0-4961}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 15:13, 21 March 2018
Gene Tiso_gene_7025
- right end position:
- 10277
- transcription direction:
- NEGATIVE
- left end position:
- 9076
- centisome position:
- 78.140335
- Synonym(s):
Reactions associated
- Reaction: DNA-DIRECTED-DNA-POLYMERASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN0-4961
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation