Difference between revisions of "Tiso gene 11437"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-HYDROXYMETHYL-METHYL-PYR-P AMINO-HYDROXYMETHYL-METHYL-PYR-P] == * smiles: ** CC1(N=CC(COP...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5059 PWY-5059] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-58024 TAX-5...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-HYDROXYMETHYL-METHYL-PYR-P AMINO-HYDROXYMETHYL-METHYL-PYR-P] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5059 PWY-5059] ==
−
* smiles:
+
* taxonomic range:
−
** CC1(N=CC(COP(=O)([O-])[O-])=C(N=1)N)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-58024 TAX-58024]
−
* inchi key:
+
−
** InChIKey=PKYFHKIYHBRTPI-UHFFFAOYSA-L
+
 
* common name:
 
* common name:
−
** 4-amino-2-methyl-5-(phosphooxymethyl)pyrimidine
+
** pinobanksin biosynthesis
−
* molecular weight:
+
−
** 217.121   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 4-amino-5-phosphomethyl-2-methylpyrimidine
 
−
** HMP-P
 
−
** 4-amino-5-hydroxymethyl-2-methylpyrimidine-phosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[PYRIMSYN3-RXN]]
+
'''2''' reactions found over '''4''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[RXN-7647]]
−
== Reaction(s) of unknown directionality ==
+
** 2 associated gene(s):
 +
*** [[Tiso_gene_9838]]
 +
*** [[Tiso_gene_13414]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-7648]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_3330]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7645 RXN-7645]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7689 RXN-7689]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-58024}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244846 25244846]
+
{{#set: common name=pinobanksin biosynthesis}}
−
* CHEBI:
+
{{#set: reaction found=2}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58354 58354]
+
{{#set: total reaction=4}}
−
* BIGG : 4ampm
+
{{#set: completion rate=50.0}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C04556 C04556]
+
−
{{#set: smiles=CC1(N=CC(COP(=O)([O-])[O-])=C(N=1)N)}}
+
−
{{#set: inchi key=InChIKey=PKYFHKIYHBRTPI-UHFFFAOYSA-L}}
+
−
{{#set: common name=4-amino-2-methyl-5-(phosphooxymethyl)pyrimidine}}
+
−
{{#set: molecular weight=217.121    }}
+
−
{{#set: common name=4-amino-5-phosphomethyl-2-methylpyrimidine|HMP-P|4-amino-5-hydroxymethyl-2-methylpyrimidine-phosphate}}
+
−
{{#set: consumed by=PYRIMSYN3-RXN}}
+

Revision as of 16:16, 21 March 2018

Pathway PWY-5059

  • taxonomic range:
  • common name:
    • pinobanksin biosynthesis
  • Synonym(s):

Reaction(s) found

2 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_11437&oldid=33204"