Difference between revisions of "3.4.21.4-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_6599 == * left end position: ** 12080 * transcription direction: ** NEGATIVE * right end position: ** 16553 * centisome position: ** 72.184...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8355 CPD-8355] == * smiles: ** CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O * common n...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_6599 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8355 CPD-8355] ==
−
* left end position:
+
* smiles:
−
** 12080
+
** CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O
−
* transcription direction:
+
* common name:
−
** NEGATIVE
+
** 1-18:1-2-lysophosphatidylethanolamine
−
* right end position:
+
* inchi key:
−
** 16553
+
** InChIKey=PYVRVRFVLRNJLY-MZMPXXGTSA-N
−
* centisome position:
+
* molecular weight:
−
** 72.184044    
+
** 479.593    
 
* Synonym(s):
 
* Synonym(s):
 +
** 1-18:1-lysoPE
 +
** 1-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[ATPASE-RXN]]
+
* [[RXN-15035]]
−
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
−
***ec-number
+
* [[RXN-15067]]
−
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
 +
* [[RXN-15036]]
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=12080}}
+
* PUBCHEM:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=58177709 58177709]
−
{{#set: right end position=16553}}
+
* CHEBI:
−
{{#set: centisome position=72.184044   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74971 74971]
−
{{#set: reaction associated=ATPASE-RXN}}
+
* HMDB : HMDB11506
 +
{{#set: smiles=CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O}}
 +
{{#set: common name=1-18:1-2-lysophosphatidylethanolamine}}
 +
{{#set: inchi key=InChIKey=PYVRVRFVLRNJLY-MZMPXXGTSA-N}}
 +
{{#set: molecular weight=479.593   }}
 +
{{#set: common name=1-18:1-lysoPE|1-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine}}
 +
{{#set: consumed by=RXN-15035}}
 +
{{#set: produced by=RXN-15067}}
 +
{{#set: reversible reaction associated=RXN-15036}}

Revision as of 15:17, 21 March 2018

Metabolite CPD-8355

  • smiles:
    • CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O
  • common name:
    • 1-18:1-2-lysophosphatidylethanolamine
  • inchi key:
    • InChIKey=PYVRVRFVLRNJLY-MZMPXXGTSA-N
  • molecular weight:
    • 479.593
  • Synonym(s):
    • 1-18:1-lysoPE
    • 1-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=3.4.21.4-RXN&oldid=33300"