Difference between revisions of "Tiso gene 15686"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19168 CPD-19168] == * smiles: ** CCCCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6632 PWY-6632] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19168 CPD-19168] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6632 PWY-6632] ==
−
* smiles:
+
* taxonomic range:
−
** CCCCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
* inchi key:
+
−
** InChIKey=KZLHPKRIEDLQGG-SQUPIXLDSA-J
+
 
* common name:
 
* common name:
−
** (S)-3-hydroxy-(7Z)-hexadecenoyl-CoA
+
** caffeine degradation IV (bacteria, via demethylation and oxidation)
−
* molecular weight:
+
−
** 1015.898   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (S)-3-hydroxy-16:1-Δ7-CoA
 
−
** (S)-3-hydroxy-7-cis-hexadecenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-17781]]
+
'''4''' reactions found over '''5''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[PWY-6538]]
−
== Reaction(s) of unknown directionality ==
+
** 0 associated gene:
 +
* [[RXN-11519]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_11775]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
* [[RXN-11520]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_11775]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
* [[RXN-11521]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_11775]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
* UM-BBD-PWY : caf
−
{{#set: inchi key=InChIKey=KZLHPKRIEDLQGG-SQUPIXLDSA-J}}
+
* LIGAND-MAP:
−
{{#set: common name=(S)-3-hydroxy-(7Z)-hexadecenoyl-CoA}}
+
** [http://www.genome.jp/dbget-bin/www_bget?map00232 map00232]
−
{{#set: molecular weight=1015.898    }}
+
{{#set: taxonomic range=TAX-2}}
−
{{#set: common name=(S)-3-hydroxy-16:1-Δ7-CoA|(S)-3-hydroxy-7-cis-hexadecenoyl-CoA}}
+
{{#set: common name=caffeine degradation IV (bacteria, via demethylation and oxidation)}}
−
{{#set: consumed by=RXN-17781}}
+
{{#set: reaction found=4}}
 +
{{#set: total reaction=5}}
 +
{{#set: completion rate=80.0}}

Revision as of 16:18, 21 March 2018

Pathway PWY-6632

  • taxonomic range:
  • common name:
    • caffeine degradation IV (bacteria, via demethylation and oxidation)
  • Synonym(s):

Reaction(s) found

4 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_15686&oldid=33442"