Difference between revisions of "PWY-6369"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14117 RXN-14117] == * direction: ** REVERSIBLE * common name: ** pyruvate_kinase * ec number: *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ATROPINE ATROPINE] == * smiles: ** C[N+]1(C2(CC(CC1CC2)OC(=O)C(CO)C3(C=CC=CC=3))) * common name...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ATROPINE ATROPINE] == |
| − | * | + | * smiles: |
| − | ** | + | ** C[N+]1(C2(CC(CC1CC2)OC(=O)C(CO)C3(C=CC=CC=3))) |
* common name: | * common name: | ||
| − | ** | + | ** atropine |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=RKUNBYITZUJHSG-SPUOUPEWSA-O |
| + | * molecular weight: | ||
| + | ** 290.381 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** d1-hyoscyamine | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | * [[TROPINESTERASE-RXN]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | = | + | |
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | * | + | * CAS : 51-55-8 |
| − | ** [http://www.ebi.ac.uk/ | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21608699 21608699] |
| − | {{#set: common name= | + | * HMDB : HMDB00779 |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01479 C01479] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | + | ** [http://www.chemspider.com/Chemical-Structure.10246419.html 10246419] | |
| − | + | * CHEBI: | |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57858 57858] |
| + | {{#set: smiles=C[N+]1(C2(CC(CC1CC2)OC(=O)C(CO)C3(C=CC=CC=3)))}} | ||
| + | {{#set: common name=atropine}} | ||
| + | {{#set: inchi key=InChIKey=RKUNBYITZUJHSG-SPUOUPEWSA-O}} | ||
| + | {{#set: molecular weight=290.381 }} | ||
| + | {{#set: common name=d1-hyoscyamine}} | ||
| + | {{#set: consumed by=TROPINESTERASE-RXN}} | ||
Revision as of 15:19, 21 March 2018
Contents
Metabolite ATROPINE
- smiles:
- C[N+]1(C2(CC(CC1CC2)OC(=O)C(CO)C3(C=CC=CC=3)))
- common name:
- atropine
- inchi key:
- InChIKey=RKUNBYITZUJHSG-SPUOUPEWSA-O
- molecular weight:
- 290.381
- Synonym(s):
- d1-hyoscyamine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 51-55-8
- PUBCHEM:
- HMDB : HMDB00779
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
"C[N+]1(C2(CC(CC1CC2)OC(=O)C(CO)C3(C=CC=CC=3)))" cannot be used as a page name in this wiki.
