Difference between revisions of "PWY-6673"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SCOPOLIN SCOPOLIN] == * smiles: ** COC2(=CC1(=C(OC(C=C1)=O)C=C2OC3(C(C(C(O)C(CO)O3)O)O))) * inc...") |
(Created page with "Category:Gene == Gene Tiso_gene_7038 == * right end position: ** 2896 * transcription direction: ** POSITIVE * left end position: ** 618 * centisome position: ** 3.5737004...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_7038 == |
− | * | + | * right end position: |
− | ** | + | ** 2896 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 618 |
− | * | + | * centisome position: |
− | ** | + | ** 3.5737004 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[1.5.1.9-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | == | + | *** Assignment: automated-name-match |
+ | == Pathways associated == | ||
+ | * [[LYSINE-DEG1-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=2896}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=618}} | |
− | + | {{#set: centisome position=3.5737004 }} | |
− | + | {{#set: reaction associated=1.5.1.9-RXN}} | |
− | + | {{#set: pathway associated=LYSINE-DEG1-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 16:21, 21 March 2018
Gene Tiso_gene_7038
- right end position:
- 2896
- transcription direction:
- POSITIVE
- left end position:
- 618
- centisome position:
- 3.5737004
- Synonym(s):
Reactions associated
- Reaction: 1.5.1.9-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation