Difference between revisions of "RXN3O-9780"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLL-A CHLOROPHYLL-A] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-581 PWY-581] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-330...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLL-A CHLOROPHYLL-A] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-581 PWY-581] ==
−
* smiles:
+
* taxonomic range:
−
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
 
* common name:
 
* common name:
−
** chlorophyll a
+
** indole-3-acetate biosynthesis II
−
* molecular weight:
+
−
** 892.495   
+
 
* Synonym(s):
 
* Synonym(s):
−
** chlorophyll a (phytol)
+
** auxin biosynthesis
 +
** indole-3-acetic acid biosynthesis
 +
** IAA de novo synthesis
 +
** IAA biosynthesis II
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RME294]]
+
'''3''' reactions found over '''13''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[RXN-1404]]
−
* [[RXN-17428]]
+
** 1 associated gene(s):
−
* [[R06284]]
+
*** [[Tiso_gene_10996]]
−
* [[RXN-7666]]
+
** 3 reconstruction source(s) associated:
−
== Reaction(s) of unknown directionality ==
+
*** [[orthology-athaliana]]
−
* [[RXN1F-66]]
+
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-7567]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_4032]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXNN-404]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_13682]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=AROMATIC-L-AMINO-ACID-DECARBOXYLASE-RXN AROMATIC-L-AMINO-ACID-DECARBOXYLASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10139 RXN-10139]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12061 RXN-12061]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12062 RXN-12062]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12063 RXN-12063]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-1403 RXN-1403]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-1405 RXN-1405]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-1406 RXN-1406]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXNDQC-2 RXNDQC-2]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=TRYPTOPHAN-AMINOTRANSFERASE-RXN TRYPTOPHAN-AMINOTRANSFERASE-RXN]
 
== External links  ==
 
== External links  ==
−
* CAS : 479-61-8
+
* PLANTCYC : PWY-581
−
* PUBCHEM:
+
* ARACYC:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657767 90657767]
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-581 PWY-581]
−
* KNAPSACK : C00001528
+
{{#set: taxonomic range=TAX-33090}}
−
* HMDB : HMDB38578
+
{{#set: common name=indole-3-acetate biosynthesis II}}
−
* LIGAND-CPD:
+
{{#set: common name=auxin biosynthesis|indole-3-acetic acid biosynthesis|IAA de novo synthesis|IAA biosynthesis II}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05306 C05306]
+
{{#set: reaction found=3}}
−
* CHEBI:
+
{{#set: total reaction=13}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58416 58416]
+
{{#set: completion rate=23.0}}
−
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
−
{{#set: common name=chlorophyll a}}
+
−
{{#set: molecular weight=892.495    }}
+
−
{{#set: common name=chlorophyll a (phytol)}}
+
−
{{#set: consumed by=RME294}}
+
−
{{#set: produced by=RXN-17428|R06284|RXN-7666}}
+
−
{{#set: reversible reaction associated=RXN1F-66}}
+

Revision as of 15:23, 21 March 2018

Pathway PWY-581

  • taxonomic range:
  • common name:
    • indole-3-acetate biosynthesis II
  • Synonym(s):
    • auxin biosynthesis
    • indole-3-acetic acid biosynthesis
    • IAA de novo synthesis
    • IAA biosynthesis II

Reaction(s) found

3 reactions found over 13 reactions in the full pathway

Reaction(s) not found

External links

  • PLANTCYC : PWY-581
  • ARACYC:




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN3O-9780&oldid=33869"