Difference between revisions of "RXN0-1603"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-1-GLYCEROPHOSPHORYLETHANOL-AMINE L-1-GLYCEROPHOSPHORYLETHANOL-AMINE] == * smiles: ** C(OP([O-...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7735 PWY-7735] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-201174 TAX-...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-1-GLYCEROPHOSPHORYLETHANOL-AMINE L-1-GLYCEROPHOSPHORYLETHANOL-AMINE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7735 PWY-7735] ==
* smiles:
+
* taxonomic range:
** C(OP([O-])(OCC(CO)O)=O)C[N+]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-201174 TAX-201174]
* inchi key:
+
** InChIKey=JZNWSCPGTDBMEW-RXMQYKEDSA-N
+
 
* common name:
 
* common name:
** sn-glycero-3-phosphoethanolamine
+
** echinomycin and triostin A biosynthesis
* molecular weight:
+
** 215.142   
+
 
* Synonym(s):
 
* Synonym(s):
** L-1-glycerophosphorylethanolamine
 
** 1-glycerophosphorylethanolamine
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-14160]]
+
'''1''' reactions found over '''6''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[RXN-17155]]
* [[RXN-15035]]
+
** 1 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_13815]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17156 RXN-17156]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17157 RXN-17157]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17159 RXN-17159]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17160 RXN-17160]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17166 RXN-17166]
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-201174}}
** [http://www.genome.jp/dbget-bin/www_bget?C01233 C01233]
+
{{#set: common name=echinomycin and triostin A biosynthesis}}
* CHEBI:
+
{{#set: reaction found=1}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16929 16929]
+
{{#set: total reaction=6}}
* BIGG : g3pe
+
{{#set: completion rate=17.0}}
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70678815 70678815]
+
* HMDB : HMDB00114
+
{{#set: smiles=C(OP([O-])(OCC(CO)O)=O)C[N+]}}
+
{{#set: inchi key=InChIKey=JZNWSCPGTDBMEW-RXMQYKEDSA-N}}
+
{{#set: common name=sn-glycero-3-phosphoethanolamine}}
+
{{#set: molecular weight=215.142    }}
+
{{#set: common name=L-1-glycerophosphorylethanolamine|1-glycerophosphorylethanolamine}}
+
{{#set: consumed by=RXN-14160}}
+
{{#set: produced by=RXN-15035}}
+

Revision as of 16:23, 21 March 2018

Pathway PWY-7735

  • taxonomic range:
  • common name:
    • echinomycin and triostin A biosynthesis
  • Synonym(s):

Reaction(s) found

1 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links