Difference between revisions of "3-oxo-cerotoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DHRT_2mbcoa DHRT_2mbcoa] == * direction: ** LEFT-TO-RIGHT * common name: ** dihydrolipoyllysine-res...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12017 CPD-12017] == * smiles: ** CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12)) * common na...")
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=DHRT_2mbcoa DHRT_2mbcoa] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12017 CPD-12017] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12))
 
* common name:
 
* common name:
** dihydrolipoyllysine-residue (2-methylpropanoyl)transferase, 2-Methylbutanoyl-CoA forming
+
** N-acetyl-serotonin sulfate
 +
* inchi key:
 +
** InChIKey=UCAJZNVFRVLULS-UHFFFAOYSA-M
 +
* molecular weight:
 +
** 297.305   
 
* Synonym(s):
 
* Synonym(s):
 +
** N-acetyl-5-hydroxytryptamine sulfate
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1.0 [[CO-A]][m] '''+''' 1.0 [[CPD-941]][m] '''=>''' 1.0 [[DIHYDROLIPOAMIDE]][m] '''+''' 1.0 [[2-METHYL-BUTYRYL-COA]][m]
+
* [[RXN-11059]]
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1.0 coenzyme A[m] '''+''' 1.0 S-(2-methylbutanoyl)-dihydrolipoamide[m] '''=>''' 1.0 dihydrolipoamide[m] '''+''' 1.0 2-methylbutanoyl-CoA[m]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Tiso_gene_11793]]
+
** [[pantograph]]-[[creinhardtii]]
+
== Pathways  ==
+
== Reconstruction information  ==
+
* Category: [[orthology]]
+
** Source: [[orthology-creinhardtii]]
+
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: common name=dihydrolipoyllysine-residue (2-methylpropanoyl)transferase, 2-Methylbutanoyl-CoA forming}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102514958 102514958]
{{#set: gene associated=Tiso_gene_11793}}
+
* HMDB : HMDB60834
{{#set: in pathway=}}
+
{{#set: smiles=CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12))}}
{{#set: reconstruction category=orthology}}
+
{{#set: common name=N-acetyl-serotonin sulfate}}
{{#set: reconstruction source=orthology-creinhardtii}}
+
{{#set: inchi key=InChIKey=UCAJZNVFRVLULS-UHFFFAOYSA-M}}
{{#set: reconstruction tool=pantograph}}
+
{{#set: molecular weight=297.305    }}
 +
{{#set: common name=N-acetyl-5-hydroxytryptamine sulfate}}
 +
{{#set: produced by=RXN-11059}}

Revision as of 15:24, 21 March 2018

Metabolite CPD-12017

  • smiles:
    • CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12))
  • common name:
    • N-acetyl-serotonin sulfate
  • inchi key:
    • InChIKey=UCAJZNVFRVLULS-UHFFFAOYSA-M
  • molecular weight:
    • 297.305
  • Synonym(s):
    • N-acetyl-5-hydroxytryptamine sulfate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12))" cannot be used as a page name in this wiki.