Difference between revisions of "Tiso gene 18343"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12869 RXN-12869] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1103 CPD-1103] == * smiles: ** C1(C=C(O)C=CC=1C(OC2(OC(CO)C(O)C(O)C(O)2))C#N) * common name...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12869 RXN-12869] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1103 CPD-1103] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C1(C=C(O)C=CC=1C(OC2(OC(CO)C(O)C(O)C(O)2))C#N)
 +
* common name:
 +
** taxiphyllin
 +
* inchi key:
 +
** InChIKey=NVLTYOJHPBMILU-GMDXDWKASA-N
 +
* molecular weight:
 +
** 311.291   
 
* Synonym(s):
 
* Synonym(s):
 +
** (R)-4-hydroxymandelonitrile β-D-glucoside
 +
** (2R)-(β-D-glucopyranosyloxy)(4-hydroxyphenyl)acetonitrile
 +
** (R)-alpha-(β-D-glucopyranosyloxy)-4-hydroxybenzeneacetonitrile
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-13600]]
−
** 2 [[L-DEHYDRO-ASCORBATE]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 2 [[PROTON]][c] '''+''' 2 [[CPD-13914]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 2 L-dehydro-ascorbate[c] '''+''' 1 oxygen[c] '''=>''' 2 H+[c] '''+''' 2 cyclic-2,3-O-oxalyl-L-threonate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[PWY-6960]], L-ascorbate degradation III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6960 PWY-6960]
+
−
** '''3''' reactions found over '''6''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CAS : 21401-21-8
−
{{#set: in pathway=PWY-6960}}
+
* PUBCHEM:
−
{{#set: reconstruction category=annotation}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=107721 107721]
−
{{#set: reconstruction source=annotation-in-silico_annotation}}
+
* HMDB : HMDB30704
−
{{#set: reconstruction tool=pathwaytools}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C01855 C01855]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.96890.html 96890]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16267 16267]
 +
{{#set: smiles=C1(C=C(O)C=CC=1C(OC2(OC(CO)C(O)C(O)C(O)2))C#N)}}
 +
{{#set: common name=taxiphyllin}}
 +
{{#set: inchi key=InChIKey=NVLTYOJHPBMILU-GMDXDWKASA-N}}
 +
{{#set: molecular weight=311.291    }}
 +
{{#set: common name=(R)-4-hydroxymandelonitrile β-D-glucoside|(2R)-(β-D-glucopyranosyloxy)(4-hydroxyphenyl)acetonitrile|(R)-alpha-(β-D-glucopyranosyloxy)-4-hydroxybenzeneacetonitrile}}
 +
{{#set: consumed by=RXN-13600}}

Revision as of 15:25, 21 March 2018

Metabolite CPD-1103

  • smiles:
    • C1(C=C(O)C=CC=1C(OC2(OC(CO)C(O)C(O)C(O)2))C#N)
  • common name:
    • taxiphyllin
  • inchi key:
    • InChIKey=NVLTYOJHPBMILU-GMDXDWKASA-N
  • molecular weight:
    • 311.291
  • Synonym(s):
    • (R)-4-hydroxymandelonitrile β-D-glucoside
    • (2R)-(β-D-glucopyranosyloxy)(4-hydroxyphenyl)acetonitrile
    • (R)-alpha-(β-D-glucopyranosyloxy)-4-hydroxybenzeneacetonitrile

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_18343&oldid=34051"