Difference between revisions of "Cis-cis-D17-35-3-hydroxyC54-2-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BUTYRYL-COA BUTYRYL-COA] == * smiles: ** CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Long-Chain-Acyl-ACPs Long-Chain-Acyl-ACPs] == * common name: ** a long-chain acyl-[acyl-carrier...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BUTYRYL-COA BUTYRYL-COA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Long-Chain-Acyl-ACPs Long-Chain-Acyl-ACPs] ==
−
* smiles:
+
−
** CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
−
* inchi key:
+
−
** InChIKey=CRFNGMNYKDXRTN-HDRJHVAISA-J
+
 
* common name:
 
* common name:
−
** butanoyl-CoA
+
** a long-chain acyl-[acyl-carrier protein]
−
* molecular weight:
+
−
** 833.593   
+
 
* Synonym(s):
 
* Synonym(s):
−
** butyryl-CoA
+
** a long-chain acyl-[acp]
−
** butyryl-coenzyme A
+
** a fatty acyl-[acp]
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-12565]]
+
* [[RXN-16067]]
−
* [[ACOA40or]]
+
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[BNorh]]
 
−
* [[BNor]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[RXN-14193]]
 
−
* [[BCor]]
 
 
== External links  ==
 
== External links  ==
−
* UM-BBD-CPD : c0023
+
{{#set: common name=a long-chain acyl-[acyl-carrier protein]}}
−
* CAS : 2140-48-9
+
{{#set: common name=a long-chain acyl-[acp]|a fatty acyl-[acp]}}
−
* METABOLIGHTS : MTBLC57371
+
{{#set: consumed by=RXN-16067}}
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244513 25244513]
+
−
* HMDB : HMDB01088
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00136 C00136]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57371 57371]
+
−
* BIGG : btcoa
+
−
{{#set: smiles=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=CRFNGMNYKDXRTN-HDRJHVAISA-J}}
+
−
{{#set: common name=butanoyl-CoA}}
+
−
{{#set: molecular weight=833.593    }}
+
−
{{#set: common name=butyryl-CoA|butyryl-coenzyme A}}
+
−
{{#set: consumed by=RXN-12565|ACOA40or}}
+
−
{{#set: produced by=BNorh|BNor}}
+
−
{{#set: reversible reaction associated=RXN-14193|BCor}}
+

Revision as of 16:27, 21 March 2018

Metabolite Long-Chain-Acyl-ACPs

  • common name:
    • a long-chain acyl-[acyl-carrier protein]
  • Synonym(s):
    • a long-chain acyl-[acp]
    • a fatty acyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a long-chain acyl-[acyl-carrier protein" cannot be used as a page name in this wiki.
  • "a long-chain acyl-[acp" cannot be used as a page name in this wiki.
  • "a fatty acyl-[acp" cannot be used as a page name in this wiki.
Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Cis-cis-D17-35-3-hydroxyC54-2-ACPs&oldid=34214"