Difference between revisions of "PWY-6118"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7280 CPD-7280] == * smiles: ** CC(C=CC=C(C)C=CC12(OC(CC(O)CC(C)(C)1)2))=CC=CC=C(C)CC=O * in...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5756 PWY-5756] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-31...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5756 PWY-5756] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-3193] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** saponin biosynthesis II |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** oleanolate glucuronide triterpene saponin biosynthesis | ||
| + | ** oleanolate glucuronide biosynthesis | ||
| + | ** triterpene saponin biosynthesis II | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | == Reaction(s) | + | '''1''' reactions found over '''8''' reactions in the full pathway |
| − | * [[RXN- | + | * [[RXN-9000]] |
| − | == | + | ** 2 associated gene(s): |
| + | *** [[Tiso_gene_14140]] | ||
| + | *** [[Tiso_gene_14141]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9001 RXN-9001] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9002 RXN-9002] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9004 RXN-9004] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9005 RXN-9005] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9006 RXN-9006] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9007 RXN-9007] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9008 RXN-9008] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-3193}} | |
| − | + | {{#set: common name=saponin biosynthesis II}} | |
| − | {{#set: | + | {{#set: common name=oleanolate glucuronide triterpene saponin biosynthesis|oleanolate glucuronide biosynthesis|triterpene saponin biosynthesis II}} |
| − | {{#set: | + | {{#set: reaction found=1}} |
| − | {{#set: | + | {{#set: total reaction=8}} |
| − | {{#set: | + | {{#set: completion rate=13.0}} |
| − | {{#set: | + | |
Revision as of 16:28, 21 March 2018
Pathway PWY-5756
- taxonomic range:
- common name:
- saponin biosynthesis II
- Synonym(s):
- oleanolate glucuronide triterpene saponin biosynthesis
- oleanolate glucuronide biosynthesis
- triterpene saponin biosynthesis II
Reaction(s) found
1 reactions found over 8 reactions in the full pathway
- RXN-9000
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
