Difference between revisions of "CPD1F-118"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1534 PWY0-1534] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16458 CPD-16458] == * smiles: ** C2(=O)(C1(=C(NCC=N1)NC(=O)N2)) * common name: ** 7,8-dihyd...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16458 CPD-16458] == |
| − | * | + | * smiles: |
| − | ** | + | ** C2(=O)(C1(=C(NCC=N1)NC(=O)N2)) |
* common name: | * common name: | ||
| − | ** | + | ** 7,8-dihydrolumazine |
| + | * inchi key: | ||
| + | ** InChIKey=MYJNEEHZESREMO-UHFFFAOYSA-N | ||
| + | * molecular weight: | ||
| + | ** 166.139 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-15261]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | |
| − | + | ||
== External links == | == External links == | ||
| − | * | + | * PUBCHEM: |
| − | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=590555 590555] |
| − | {{#set: | + | {{#set: smiles=C2(=O)(C1(=C(NCC=N1)NC(=O)N2))}} |
| − | {{#set: common name= | + | {{#set: common name=7,8-dihydrolumazine}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=MYJNEEHZESREMO-UHFFFAOYSA-N}} |
| − | {{#set: | + | {{#set: molecular weight=166.139 }} |
| − | {{#set: | + | {{#set: produced by=RXN-15261}} |
Revision as of 16:29, 21 March 2018
Contents
Metabolite CPD-16458
- smiles:
- C2(=O)(C1(=C(NCC=N1)NC(=O)N2))
- common name:
- 7,8-dihydrolumazine
- inchi key:
- InChIKey=MYJNEEHZESREMO-UHFFFAOYSA-N
- molecular weight:
- 166.139
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
