Difference between revisions of "Protein-Ox-Disulfides"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ENOL-PHENYLPYRUVATE ENOL-PHENYLPYRUVATE] == * smiles: ** C([O-])(=O)C(O)=CC1(C=CC=CC=1) * inchi...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Pimeloyl-ACP-methyl-esters Pimeloyl-ACP-methyl-esters] == * common name: ** a pimeloyl-[acp] me...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Pimeloyl-ACP-methyl-esters Pimeloyl-ACP-methyl-esters] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a pimeloyl-[acp] methyl ester |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** a pimelyl-[acp] methyl ester | ||
| + | ** a pimeloyl-[acyl-carrier protein] methyl ester | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-11482]] |
| + | * [[EPMEACPR]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=a pimeloyl-[acp] methyl ester}} | |
| − | + | {{#set: common name=a pimelyl-[acp] methyl ester|a pimeloyl-[acyl-carrier protein] methyl ester}} | |
| − | + | {{#set: produced by=RXN-11482|EPMEACPR}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | {{#set: produced by= | + | |
Revision as of 15:30, 21 March 2018
Contents
Metabolite Pimeloyl-ACP-methyl-esters
- common name:
- a pimeloyl-[acp] methyl ester
- Synonym(s):
- a pimelyl-[acp] methyl ester
- a pimeloyl-[acyl-carrier protein] methyl ester
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a pimeloyl-[acp] methyl ester" cannot be used as a page name in this wiki.
- "a pimelyl-[acp] methyl ester" cannot be used as a page name in this wiki.
- "a pimeloyl-[acyl-carrier protein] methyl ester" cannot be used as a page name in this wiki.
