Difference between revisions of "Tiso gene 9894"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19158 CPD-19158] == * smiles: ** CCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7984 RXN-7984] == * direction: ** LEFT-TO-RIGHT * common name: ** violaxanthin_de-epoxidase **...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19158 CPD-19158] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7984 RXN-7984] ==
−
* smiles:
+
* direction:
−
** CCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=JDNARGYWMLYADA-MDMKAECGSA-J
+
 
* common name:
 
* common name:
−
** 3-oxo-(9Z)-hexadecenoyl-CoA
+
** violaxanthin_de-epoxidase
−
* molecular weight:
+
** violaxanthin_de-_chloroplast
−
** 1013.883   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-oxo-16:1-Δ9-CoA
+
** VDE
−
** 3-oxo-9-cis-hexadecenoyl-CoA
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-17791]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[PROTON]][c] '''+''' 1 [[CPD1F-133]][c] '''+''' 1 [[ASCORBATE]][c] '''=>''' 1 [[CPD1F-131]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[L-DEHYDRO-ASCORBATE]][c]
−
* [[RXN-17790]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 H+[c] '''+''' 1 violaxanthin[c] '''+''' 1 L-ascorbate[c] '''=>''' 1 antheraxanthin[c] '''+''' 1 H2O[c] '''+''' 1 L-dehydro-ascorbate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_16523]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_1275]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_5666]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-5945]], zeaxanthin, antheraxanthin and violaxanthin interconversion: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5945 PWY-5945]
 +
** '''4''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
* RHEA:
−
{{#set: inchi key=InChIKey=JDNARGYWMLYADA-MDMKAECGSA-J}}
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=15353 15353]
−
{{#set: common name=3-oxo-(9Z)-hexadecenoyl-CoA}}
+
* LIGAND-RXN:
−
{{#set: molecular weight=1013.883    }}
+
** [http://www.genome.jp/dbget-bin/www_bget?R07178 R07178]
−
{{#set: common name=3-oxo-16:1-Δ9-CoA|3-oxo-9-cis-hexadecenoyl-CoA}}
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: consumed by=RXN-17791}}
+
{{#set: common name=violaxanthin_de-epoxidase}}
−
{{#set: produced by=RXN-17790}}
+
{{#set: common name=violaxanthin_de-_chloroplast}}
 +
{{#set: common name=VDE}}
 +
{{#set: gene associated=Tiso_gene_16523|Tiso_gene_1275|Tiso_gene_5666}}
 +
{{#set: in pathway=PWY-5945}}
 +
{{#set: reconstruction category=orthology|annotation}}
 +
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}}
 +
{{#set: reconstruction tool=pantograph|pathwaytools}}

Revision as of 15:32, 21 March 2018

Reaction RXN-7984

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • violaxanthin_de-epoxidase
    • violaxanthin_de-_chloroplast
  • Synonym(s):
    • VDE

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5945, zeaxanthin, antheraxanthin and violaxanthin interconversion: PWY-5945
    • 4 reactions found over 4 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_9894&oldid=34676"