|
|
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=S-ADENMETSYN-RXN S-ADENMETSYN-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7015 CPD-7015] == |
− | * direction: | + | * smiles: |
− | ** LEFT-TO-RIGHT | + | ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(CO)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9)))) |
| * common name: | | * common name: |
− | ** S-adenosylmethionine synthase 1 | + | ** 71-hydroxychlorophyllide a |
− | * ec number: | + | * molecular weight: |
− | ** [http://enzyme.expasy.org/EC/2.5.1.6 EC-2.5.1.6] | + | ** 628.966 |
| * Synonym(s): | | * Synonym(s): |
| + | ** 7-hydroxychlorophyllide a (misleading) |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | * [[RXN-7677]] |
− | ** 1 [[ATP]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[MET]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''+''' 1 [[PPI]][c]
| + | == Reaction(s) known to produce the compound == |
− | * With common name(s):
| + | * [[RXN-7676]] |
− | ** 1 ATP[c] '''+''' 1 H2O[c] '''+''' 1 L-methionine[c] '''=>''' 1 phosphate[c] '''+''' 1 S-adenosyl-L-methionine[c] '''+''' 1 diphosphate[c]
| + | == Reaction(s) of unknown directionality == |
− | | + | |
− | == Genes associated with this reaction == | + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Tiso_gene_13443]] | + | |
− | ** EXPERIMENTAL_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[athaliana]]
| + | |
− | ** [[pantograph]]-[[synechocystis]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | ** [[pantograph]]-[[creinhardtii]]
| + | |
− | == Pathways == | + | |
− | * [[SAM-PWY]], S-adenosyl-L-methionine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=SAM-PWY SAM-PWY]
| + | |
− | ** '''1''' reactions found over '''1''' reactions in the full pathway
| + | |
− | * [[METHIONINE-DEG1-PWY]], L-methionine degradation I (to L-homocysteine): [http://metacyc.org/META/NEW-IMAGE?object=METHIONINE-DEG1-PWY METHIONINE-DEG1-PWY]
| + | |
− | ** '''3''' reactions found over '''3''' reactions in the full pathway
| + | |
− | * [[ETHYL-PWY]], ethylene biosynthesis I (plants): [http://metacyc.org/META/NEW-IMAGE?object=ETHYL-PWY ETHYL-PWY]
| + | |
− | ** '''2''' reactions found over '''3''' reactions in the full pathway
| + | |
− | * [[PWY-5912]], 2'-deoxymugineic acid phytosiderophore biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5912 PWY-5912]
| + | |
− | ** '''1''' reactions found over '''4''' reactions in the full pathway
| + | |
− | * [[PWY-5041]], S-adenosyl-L-methionine cycle II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5041 PWY-5041] | + | |
− | ** '''4''' reactions found over '''4''' reactions in the full pathway
| + | |
− | == Reconstruction information == | + | |
− | * Category: [[orthology]]
| + | |
− | ** Source: [[orthology-athaliana]]
| + | |
− | *** Tool: [[pantograph]]
| + | |
− | ** Source: [[orthology-creinhardtii]]
| + | |
− | *** Tool: [[pantograph]]
| + | |
− | ** Source: [[orthology-synechocystis]]
| + | |
− | *** Tool: [[pantograph]]
| + | |
− | ** Source: [[orthology-esiliculosus]]
| + | |
− | *** Tool: [[pantograph]]
| + | |
− | * Category: [[manual]]
| + | |
− | ** Source: [[manual-primary_network]]
| + | |
− | * Category: [[annotation]]
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * PUBCHEM: |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=21080 21080] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657206 90657206] |
− | * LIGAND-RXN: | + | * LIGAND-CPD: |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R00177 R00177] | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16540 C16540] |
− | * UNIPROT:
| + | {{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(CO)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}} |
− | ** [http://www.uniprot.org/uniprot/P19358 P19358]
| + | {{#set: common name=71-hydroxychlorophyllide a}} |
− | ** [http://www.uniprot.org/uniprot/P18298 P18298]
| + | {{#set: molecular weight=628.966 }} |
− | ** [http://www.uniprot.org/uniprot/Q91X83 Q91X83]
| + | {{#set: common name=7-hydroxychlorophyllide a (misleading)}} |
− | ** [http://www.uniprot.org/uniprot/Q9PNJ8 Q9PNJ8]
| + | {{#set: consumed by=RXN-7677}} |
− | ** [http://www.uniprot.org/uniprot/P54419 P54419]
| + | {{#set: produced by=RXN-7676}} |
− | ** [http://www.uniprot.org/uniprot/P56460 P56460]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JVV6 Q9JVV6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9CEE0 Q9CEE0]
| + | |
− | ** [http://www.uniprot.org/uniprot/O50163 O50163]
| + | |
− | ** [http://www.uniprot.org/uniprot/P43762 P43762]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23686 P23686]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17562 P17562]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M4Y8 Q7M4Y8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9S992 Q9S992]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90862 Q90862]
| + | |
− | ** [http://www.uniprot.org/uniprot/P13444 P13444]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31153 P31153]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q00266 Q00266]
| + | |
− | ** [http://www.uniprot.org/uniprot/P43281 P43281]
| + | |
− | ** [http://www.uniprot.org/uniprot/P40320 P40320]
| + | |
− | ** [http://www.uniprot.org/uniprot/P43280 P43280]
| + | |
− | ** [http://www.uniprot.org/uniprot/P43282 P43282]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48498 P48498]
| + | |
− | ** [http://www.uniprot.org/uniprot/P10659 P10659]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q39465 Q39465]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48466 P48466]
| + | |
− | ** [http://www.uniprot.org/uniprot/P49612 P49612]
| + | |
− | ** [http://www.uniprot.org/uniprot/P49613 P49613]
| + | |
− | ** [http://www.uniprot.org/uniprot/P78003 P78003]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q49070 Q49070]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0A817 P0A817]
| + | |
− | ** [http://www.uniprot.org/uniprot/P50299 P50299]
| + | |
− | ** [http://www.uniprot.org/uniprot/O22350 O22350]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24260 P24260]
| + | |
− | ** [http://www.uniprot.org/uniprot/O60198 O60198]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q12642 Q12642]
| + | |
− | {{#set: direction=LEFT-TO-RIGHT}}
| + | |
− | {{#set: common name=S-adenosylmethionine synthase 1}} | + | |
− | {{#set: ec number=EC-2.5.1.6}} | + | |
− | {{#set: gene associated=Tiso_gene_13443}} | + | |
− | {{#set: in pathway=SAM-PWY|METHIONINE-DEG1-PWY|ETHYL-PWY|PWY-5912|PWY-5041}} | + | |
− | {{#set: reconstruction category=orthology|manual|annotation}} | + | |
− | {{#set: reconstruction source=annotation-experimental_annotation|orthology-esiliculosus|orthology-athaliana|orthology-synechocystis|manual-primary_network|orthology-creinhardtii}}
| + | |
− | {{#set: reconstruction tool=pantograph|pathwaytools}}
| + | |