Difference between revisions of "CDP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-METHYL-MYO-INOSITOL 4-METHYL-MYO-INOSITOL] == * smiles: ** COC1(C(O)C(O)C(O)C(O)C(O)1) * inch...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-4-D-xylooligosaccharides 1-4-D-xylooligosaccharides] == * common name: ** a (1->4)-β-D-x...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-4-D-xylooligosaccharides 1-4-D-xylooligosaccharides] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** D- | + | ** a (1->4)-β-D-xylan oligosaccharide |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[3.2.1.37-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | + | {{#set: common name=a (1->4)-β-D-xylan oligosaccharide}} | |
− | + | {{#set: consumed by=3.2.1.37-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 16:33, 21 March 2018
Contents
Metabolite 1-4-D-xylooligosaccharides
- common name:
- a (1->4)-β-D-xylan oligosaccharide
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a (1->4)-β-D-xylan oligosaccharide" cannot be used as a page name in this wiki.