Difference between revisions of "CPD-787"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5662 CPD-5662] == * smiles: ** C(S)C1(C(NC(N1)=O)CCCCCC(=O)[O-]) * inchi key: ** InChIKey=Z...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=G5DH G5DH] == * direction: ** LEFT-TO-RIGHT * common name: ** glutamate-5-semialdehyde dehydrogenas...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=G5DH G5DH] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** glutamate-5-semialdehyde dehydrogenase |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | = | + | ** 1.0 [[NADPH]][c] '''+''' 1.0 [[PROTON]][c] '''+''' 1.0 [[L-GLUTAMATE-5-P]][c] '''=>''' 1.0 [[L-GLUTAMATE_GAMMA-SEMIALDEHYDE]][c] '''+''' 1.0 [[NADP]][c] '''+''' 1.0 [[Pi]][c] |
| − | * [[ | + | * With common name(s): |
| − | == | + | ** 1.0 NADPH[c] '''+''' 1.0 H+[c] '''+''' 1.0 γ-L-glutamyl 5-phosphate[c] '''=>''' 1.0 L-glutamate-5-semialdehyde[c] '''+''' 1.0 NADP+[c] '''+''' 1.0 phosphate[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_16634]] | ||
| + | ** Source: [[orthology-creinhardtii]] | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-creinhardtii]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=glutamate-5-semialdehyde dehydrogenase}} | |
| − | {{#set: | + | {{#set: gene associated=Tiso_gene_16634}} |
| − | {{#set: | + | {{#set: in pathway=}} |
| − | {{#set: | + | {{#set: reconstruction category=orthology}} |
| − | {{#set: | + | {{#set: reconstruction source=orthology-creinhardtii}} |
| − | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 16:33, 21 March 2018
Contents
Reaction G5DH
- direction:
- LEFT-TO-RIGHT
- common name:
- glutamate-5-semialdehyde dehydrogenase
- Synonym(s):
Reaction Formula
- With identifiers:
- 1.0 NADPH[c] + 1.0 PROTON[c] + 1.0 L-GLUTAMATE-5-P[c] => 1.0 L-GLUTAMATE_GAMMA-SEMIALDEHYDE[c] + 1.0 NADP[c] + 1.0 Pi[c]
- With common name(s):
- 1.0 NADPH[c] + 1.0 H+[c] + 1.0 γ-L-glutamyl 5-phosphate[c] => 1.0 L-glutamate-5-semialdehyde[c] + 1.0 NADP+[c] + 1.0 phosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_16634
- Source: orthology-creinhardtii
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-creinhardtii
