Difference between revisions of "Rhodopsins"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUMP DUMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2)) * inchi key: **...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GTCY GTCY] == * direction: ** LEFT-TO-RIGHT * common name: ** GTP:cytidine 5'-phosphotransferase *...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GTCY GTCY] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** GTP:cytidine 5'-phosphotransferase |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | + | ** 1.0 [[GTP]][c] '''+''' 1.0 [[CYTIDINE]][c] '''=>''' 1.0 [[GDP]][c] '''+''' 1.0 [[CMP]][c] '''+''' 1.0 [[PROTON]][c] | |
| − | = | + | * With common name(s): |
| − | * [[ | + | ** 1.0 GTP[c] '''+''' 1.0 cytidine[c] '''=>''' 1.0 GDP[c] '''+''' 1.0 CMP[c] '''+''' 1.0 H+[c] |
| − | * [[ | + | |
| − | * [[ | + | == Genes associated with this reaction == |
| − | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
| − | * [[ | + | * Gene: [[Tiso_gene_14474]] |
| − | == | + | ** Source: [[orthology-creinhardtii]] |
| + | * Gene: [[Tiso_gene_20134]] | ||
| + | ** Source: [[orthology-creinhardtii]] | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-creinhardtii]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=GTP:cytidine 5'-phosphotransferase}} | |
| − | + | {{#set: gene associated=Tiso_gene_14474|Tiso_gene_20134}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction source=orthology-creinhardtii}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 15:33, 21 March 2018
Contents
Reaction GTCY
- direction:
- LEFT-TO-RIGHT
- common name:
- GTP:cytidine 5'-phosphotransferase
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1.0 GTP[c] + 1.0 cytidine[c] => 1.0 GDP[c] + 1.0 CMP[c] + 1.0 H+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_14474
- Source: orthology-creinhardtii
- Gene: Tiso_gene_20134
- Source: orthology-creinhardtii
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-creinhardtii
