Difference between revisions of "Tiso gene 18224"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17464 CPD-17464] == * smiles: ** CCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...")
(Created page with "Category:Gene == Gene Tiso_gene_18838 == * right end position: ** 1765 * transcription direction: ** POSITIVE * left end position: ** 877 * centisome position: ** 31.72937...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17464 CPD-17464] ==
+
== Gene Tiso_gene_18838 ==
−
* smiles:
+
* right end position:
−
** CCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 1765
−
* inchi key:
+
* transcription direction:
−
** InChIKey=GIIFECKTWKZXGU-FJXLYLFVSA-J
+
** POSITIVE
−
* common name:
+
* left end position:
−
** (9Z)-tetradecenoyl-CoA
+
** 877
−
* molecular weight:
+
* centisome position:
−
** 971.845    
+
** 31.729376    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[OHACYL-COA-DEHYDROG-RXN]]
−
* [[RXN-16561]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[RXN-10698]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-10702]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-10703]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-11245]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-11662]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-12490]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-12570]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-12705]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-12750]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-16133]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-17777]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-17781]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-17786]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-17790]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-17793]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-17794]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-17797]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-17798]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-905]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN0-2044]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[P162-PWY]]
 +
* [[PWY-5177]]
 +
* [[PWY-6583]]
 +
* [[PWY-6883]]
 +
* [[PWY-5136]]
 +
* [[PWY-7778]]
 +
* [[PWY-7779]]
 +
* [[PWY-7094]]
 +
* [[PWY66-391]]
 +
* [[PWY-5789]]
 +
* [[PWY-81]]
 +
* [[CENTFERM-PWY]]
 +
* [[PWY-6945]]
 +
* [[PWY0-321]]
 +
* [[PWY-7007]]
 +
* [[PWY-6435]]
 +
* [[PWY-7216]]
 +
* [[PWY-1361]]
 +
* [[PWY-6946]]
 +
* [[FAO-PWY]]
 +
* [[PWY-6944]]
 +
* [[PWY-735]]
 +
* [[PWY-7401]]
 +
* [[PWY-6863]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=1765}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70678739 70678739]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=877}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=65060 65060]
+
{{#set: centisome position=31.729376   }}
−
{{#set: smiles=CCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reaction associated=OHACYL-COA-DEHYDROG-RXN|RXN-10698|RXN-10702|RXN-10703|RXN-11245|RXN-11662|RXN-12490|RXN-12570|RXN-12705|RXN-12750|RXN-16133|RXN-17777|RXN-17781|RXN-17786|RXN-17790|RXN-17793|RXN-17794|RXN-17797|RXN-17798|RXN-905|RXN0-2044}}
−
{{#set: inchi key=InChIKey=GIIFECKTWKZXGU-FJXLYLFVSA-J}}
+
{{#set: pathway associated=P162-PWY|PWY-5177|PWY-6583|PWY-6883|PWY-5136|PWY-7778|PWY-7779|PWY-7094|PWY66-391|PWY-5789|PWY-81|CENTFERM-PWY|PWY-6945|PWY0-321|PWY-7007|PWY-6435|PWY-7216|PWY-1361|PWY-6946|FAO-PWY|PWY-6944|PWY-735|PWY-7401|PWY-6863}}
−
{{#set: common name=(9Z)-tetradecenoyl-CoA}}
+
−
{{#set: molecular weight=971.845   }}
+
−
{{#set: produced by=RXN-16561}}
+

Revision as of 15:33, 21 March 2018

Gene Tiso_gene_18838

  • right end position:
    • 1765
  • transcription direction:
    • POSITIVE
  • left end position:
    • 877
  • centisome position:
    • 31.729376
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_18224&oldid=34864"