Difference between revisions of "RXN-16626"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5641 RXN-5641] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/4....")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1133 CPD0-1133] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(O1)OC2(C(O)C(O)C(OC(CO)2)OC3(C(O)C(O)...")
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5641 RXN-5641] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1133 CPD0-1133] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** C(O)C1(C(O)C(O)C(O)C(O1)OC2(C(O)C(O)C(OC(CO)2)OC3(C(O)C(O)C(OC(CO)3)OC7(C(O)C(O)C(OC6(C(O)C(O)C(OC4(C(O)C(O)C(OC(CO)4)OC5(C(O)C(O)C(O)OC(CO)5)))OC(CO)6))OC(CO)7))))
* ec number:
+
* common name:
** [http://enzyme.expasy.org/EC/4.1.1 EC-4.1.1]
+
** maltoheptaose
 +
* inchi key:
 +
** InChIKey=BNABBHGYYMZMOA-QJBBZCPBSA-N
 +
* molecular weight:
 +
** 1153.009   
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-14286]]
** 1 [[SER]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[ETHANOL-AMINE]][c] '''+''' 1 [[CARBON-DIOXIDE]][c]
+
* [[RXN-14283]]
* With common name(s):
+
== Reaction(s) known to produce the compound ==
** 1 L-serine[c] '''+''' 1 H+[c] '''=>''' 1 ethanolamine[c] '''+''' 1 CO2[c]
+
== Reaction(s) of unknown directionality ==
 
+
== Genes associated with this reaction  ==
+
== Pathways  ==
+
* [[PWY-7782]], plasmalogen biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7782 PWY-7782]
+
** '''7''' reactions found over '''16''' reactions in the full pathway
+
* [[PWY4FS-6]], phosphatidylethanolamine biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY4FS-6 PWY4FS-6]
+
** '''4''' reactions found over '''4''' reactions in the full pathway
+
* [[PWY-3385]], choline biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3385 PWY-3385]
+
** '''2''' reactions found over '''6''' reactions in the full pathway
+
== Reconstruction information  ==
+
* Category: [[annotation]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* LIGAND-CPD:
{{#set: ec number=EC-4.1.1}}
+
** [http://www.genome.jp/dbget-bin/www_bget?G00689 G00689]
{{#set: in pathway=PWY-7782|PWY4FS-6|PWY-3385}}
+
* CHEBI:
{{#set: reconstruction category=annotation}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61954 61954]
{{#set: reconstruction source=annotation-in-silico_annotation}}
+
* METABOLIGHTS : MTBLC61954
{{#set: reconstruction tool=pathwaytools}}
+
* BIGG : malthp
 +
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=13908996 13908996]
 +
{{#set: smiles=C(O)C1(C(O)C(O)C(O)C(O1)OC2(C(O)C(O)C(OC(CO)2)OC3(C(O)C(O)C(OC(CO)3)OC7(C(O)C(O)C(OC6(C(O)C(O)C(OC4(C(O)C(O)C(OC(CO)4)OC5(C(O)C(O)C(O)OC(CO)5)))OC(CO)6))OC(CO)7))))}}
 +
{{#set: common name=maltoheptaose}}
 +
{{#set: inchi key=InChIKey=BNABBHGYYMZMOA-QJBBZCPBSA-N}}
 +
{{#set: molecular weight=1153.009    }}
 +
{{#set: consumed by=RXN-14286|RXN-14283}}

Revision as of 16:35, 21 March 2018

Metabolite CPD0-1133

  • smiles:
    • C(O)C1(C(O)C(O)C(O)C(O1)OC2(C(O)C(O)C(OC(CO)2)OC3(C(O)C(O)C(OC(CO)3)OC7(C(O)C(O)C(OC6(C(O)C(O)C(OC4(C(O)C(O)C(OC(CO)4)OC5(C(O)C(O)C(O)OC(CO)5)))OC(CO)6))OC(CO)7))))
  • common name:
    • maltoheptaose
  • inchi key:
    • InChIKey=BNABBHGYYMZMOA-QJBBZCPBSA-N
  • molecular weight:
    • 1153.009
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links