Difference between revisions of "RXN-10059"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-4 CPD1F-4] == * smiles: ** CC(=CC=CC=C(C)C=O)C=CC=C(C)C=C=C1(C(O)(C)CC(O)CC(C)(C)1) * inc...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10658 RXN-10658] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxoacyl-synthase * ec num...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-4 CPD1F-4] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10658 RXN-10658] ==
−
* smiles:
+
* direction:
−
** CC(=CC=CC=C(C)C=O)C=CC=C(C)C=C=C1(C(O)(C)CC(O)CC(C)(C)1)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=MFDUGTOOXGORRX-ORGLZDQCSA-N
+
 
* common name:
 
* common name:
−
** (3S,5R,6R)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al
+
** 3-oxoacyl-synthase
−
* molecular weight:
+
* ec number:
−
** 382.542   
+
** [http://enzyme.expasy.org/EC/2.3.1.41 EC-2.3.1.41]
 
* Synonym(s):
 
* Synonym(s):
−
** C25-allenic-apo-aldehyde
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-698]]
+
** 1 [[MALONYL-ACP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Cis-Delta7-tetradecenoyl-ACPs]][c] '''=>''' 1 [[3-oxo-cis-D9-hexadecenoyl-ACPs]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[ACP]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 a malonyl-[acp][c] '''+''' 1 H+[c] '''+''' 1 a cis-Δ7-tetradecenoyl-[acp][c] '''=>''' 1 a 3-oxo-cis-Δ9-hexadecenoyl-[acp][c] '''+''' 1 CO2[c] '''+''' 1 a holo-[acyl-carrier protein][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_14485]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_19302]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_5939]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_15991]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-6282]], palmitoleate biosynthesis I (from (5Z)-dodec-5-enoate): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6282 PWY-6282]
 +
** '''9''' reactions found over '''9''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245424 25245424]
+
{{#set: common name=3-oxoacyl-synthase}}
−
* CHEBI:
+
{{#set: ec number=EC-2.3.1.41}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=34596 34596]
+
{{#set: gene associated=Tiso_gene_14485|Tiso_gene_19302|Tiso_gene_5939|Tiso_gene_15991}}
−
* LIGAND-CPD:
+
{{#set: in pathway=PWY-6282}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C14044 C14044]
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: smiles=CC(=CC=CC=C(C)C=O)C=CC=C(C)C=C=C1(C(O)(C)CC(O)CC(C)(C)1)}}
+
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation|orthology-esiliculosus}}
−
{{#set: inchi key=InChIKey=MFDUGTOOXGORRX-ORGLZDQCSA-N}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: common name=(3S,5R,6R)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al}}
+
−
{{#set: molecular weight=382.542    }}
+
−
{{#set: common name=C25-allenic-apo-aldehyde}}
+
−
{{#set: produced by=RXN-698}}
+

Revision as of 16:35, 21 March 2018

Reaction RXN-10658

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 3-oxoacyl-synthase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6282, palmitoleate biosynthesis I (from (5Z)-dodec-5-enoate): PWY-6282
    • 9 reactions found over 9 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-10059&oldid=35025"