Difference between revisions of "URACIL-PRIBOSYLTRANS-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-420 CPD-420] == * smiles: ** CC(NC(C(=O)[O-])CC(=O)[O-])=O * inchi key: ** InChIKey=OTCCIMW...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PRODISULFREDUCT-A-RXN PRODISULFREDUCT-A-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** glu...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PRODISULFREDUCT-A-RXN PRODISULFREDUCT-A-RXN] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** glutaredoxin reductase (glutathione) |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.8.4 EC-1.8.4] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | == | + | ** 2 [[GLUTATHIONE]][c] '''+''' 1 [[Ox-Glutaredoxins]][c] '''=>''' 1 [[Red-Glutaredoxins]][c] '''+''' 1 [[OXIDIZED-GLUTATHIONE]][c] |
− | * [[ | + | * With common name(s): |
+ | ** 2 glutathione[c] '''+''' 1 an oxidized glutaredoxin[c] '''=>''' 1 a reduced glutaredoxin[c] '''+''' 1 glutathione disulfide[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | == Pathways == | ||
+ | * [[GLUT-REDOX-PWY]], glutathione-glutaredoxin redox reactions: [http://metacyc.org/META/NEW-IMAGE?object=GLUT-REDOX-PWY GLUT-REDOX-PWY] | ||
+ | ** '''2''' reactions found over '''2''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=glutaredoxin reductase (glutathione)}} | |
− | + | {{#set: ec number=EC-1.8.4}} | |
− | + | {{#set: in pathway=GLUT-REDOX-PWY}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 16:35, 21 March 2018
Contents
Reaction PRODISULFREDUCT-A-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- glutaredoxin reductase (glutathione)
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 2 GLUTATHIONE[c] + 1 Ox-Glutaredoxins[c] => 1 Red-Glutaredoxins[c] + 1 OXIDIZED-GLUTATHIONE[c]
- With common name(s):
- 2 glutathione[c] + 1 an oxidized glutaredoxin[c] => 1 a reduced glutaredoxin[c] + 1 glutathione disulfide[c]
Genes associated with this reaction
Pathways
- GLUT-REDOX-PWY, glutathione-glutaredoxin redox reactions: GLUT-REDOX-PWY
- 2 reactions found over 2 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation