Difference between revisions of "XYLULOSE-5-PHOSPHATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-ISOBUTYRYL-COA 3-HYDROXY-ISOBUTYRYL-COA] == * common name: ** 3-hydroxy-isobutanoyl-C...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE 2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE] == * smiles: ** CC(O)(...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE 2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE] == |
| + | * smiles: | ||
| + | ** CC(O)(CO)C(O)COP([O-])([O-])=O | ||
* common name: | * common name: | ||
| − | ** | + | ** 2-C-methyl-D-erythritol 4-phosphate |
| + | * inchi key: | ||
| + | ** InChIKey=XMWHRVNVKDKBRG-UHNVWZDZSA-L | ||
| + | * molecular weight: | ||
| + | ** 214.111 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** MEP |
| − | ** | + | ** 2-methylerylthritol 4-phosphate |
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[2.7.7.60-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[DXPREDISOM-RXN]] | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21608483 21608483] |
| − | {{#set: consumed by=RXN- | + | * CHEMSPIDER: |
| + | ** [http://www.chemspider.com/Chemical-Structure.10645747.html 10645747] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58262 58262] | ||
| + | * BIGG : 2me4p | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C11434 C11434] | ||
| + | {{#set: smiles=CC(O)(CO)C(O)COP([O-])([O-])=O}} | ||
| + | {{#set: common name=2-C-methyl-D-erythritol 4-phosphate}} | ||
| + | {{#set: inchi key=InChIKey=XMWHRVNVKDKBRG-UHNVWZDZSA-L}} | ||
| + | {{#set: molecular weight=214.111 }} | ||
| + | {{#set: common name=MEP|2-methylerylthritol 4-phosphate}} | ||
| + | {{#set: consumed by=2.7.7.60-RXN}} | ||
| + | {{#set: reversible reaction associated=DXPREDISOM-RXN}} | ||
Revision as of 15:36, 21 March 2018
Contents
Metabolite 2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE
- smiles:
- CC(O)(CO)C(O)COP([O-])([O-])=O
- common name:
- 2-C-methyl-D-erythritol 4-phosphate
- inchi key:
- InChIKey=XMWHRVNVKDKBRG-UHNVWZDZSA-L
- molecular weight:
- 214.111
- Synonym(s):
- MEP
- 2-methylerylthritol 4-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(O)(CO)C(O)COP([O-])([O-])=O" cannot be used as a page name in this wiki.
