Difference between revisions of "Holo-VibB"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8564 CPD-8564] == * smiles: ** C(O)C(C(=O)N[R])NC(=O)[R] * common name: ** myosin light-cha...")
(Created page with "Category:Gene == Gene Tiso_gene_12496 == * right end position: ** 4124 * transcription direction: ** NEGATIVE * left end position: ** 27 * centisome position: ** 0.3888808...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8564 CPD-8564] ==
+
== Gene Tiso_gene_12496 ==
* smiles:
+
* right end position:
** C(O)C(C(=O)N[R])NC(=O)[R]
+
** 4124
* common name:
+
* transcription direction:
** myosin light-chain
+
** NEGATIVE
 +
* left end position:
 +
** 27
 +
* centisome position:
 +
** 0.38888088   
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[ISOLEUCINE--TRNA-LIGASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-in-silico_annotation]]
* [[2.7.11.18-RXN]]
+
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[TRNA-CHARGING-PWY]]
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: right end position=4124}}
** [http://www.genome.jp/dbget-bin/www_bget?C01003 C01003]
+
{{#set: transcription direction=NEGATIVE}}
{{#set: smiles=C(O)C(C(=O)N[R])NC(=O)[R]}}
+
{{#set: left end position=27}}
{{#set: common name=myosin light-chain}}
+
{{#set: centisome position=0.38888088    }}
{{#set: reversible reaction associated=2.7.11.18-RXN}}
+
{{#set: reaction associated=ISOLEUCINE--TRNA-LIGASE-RXN}}
 +
{{#set: pathway associated=TRNA-CHARGING-PWY}}

Revision as of 15:37, 21 March 2018

Gene Tiso_gene_12496

  • right end position:
    • 4124
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 27
  • centisome position:
    • 0.38888088
  • Synonym(s):

Reactions associated

Pathways associated

External links