Difference between revisions of "GlcA-Gal-Gal-Xyl-Proteins"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-PRENYL-L-CYSTEINE S-PRENYL-L-CYSTEINE] == * smiles: ** CC(C)=CCSCC([N+])C(=O)[O-] * inchi key...")
(Created page with "Category:Gene == Gene Tiso_gene_10799 == * right end position: ** 4919 * transcription direction: ** POSITIVE * left end position: ** 3650 * centisome position: ** 27.6536...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-PRENYL-L-CYSTEINE S-PRENYL-L-CYSTEINE] ==
+
== Gene Tiso_gene_10799 ==
−
* smiles:
+
* right end position:
−
** CC(C)=CCSCC([N+])C(=O)[O-]
+
** 4919
−
* inchi key:
+
* transcription direction:
−
** InChIKey=ULHWZNASVJIOEM-ZETCQYMHSA-N
+
** POSITIVE
−
* common name:
+
* left end position:
−
** S-prenyl-L-cysteine
+
** 3650
−
* molecular weight:
+
* centisome position:
−
** 189.272    
+
** 27.65361    
 
* Synonym(s):
 
* Synonym(s):
−
** prenyl-L-cysteine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[1.8.3.5-RXN]]
+
* Reaction: [[6PGLUCONOLACT-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[P122-PWY]]
 +
* [[RUMP-PWY]]
 +
* [[OXIDATIVEPENT-PWY]]
 +
* [[GLYCOLYSIS-E-D]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=4919}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200435 25200435]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=3650}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=47914 47914]
+
{{#set: centisome position=27.65361   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=6PGLUCONOLACT-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06751 C06751]
+
{{#set: pathway associated=P122-PWY|RUMP-PWY|OXIDATIVEPENT-PWY|GLYCOLYSIS-E-D}}
−
* HMDB : HMDB12286
+
−
{{#set: smiles=CC(C)=CCSCC([N+])C(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=ULHWZNASVJIOEM-ZETCQYMHSA-N}}
+
−
{{#set: common name=S-prenyl-L-cysteine}}
+
−
{{#set: molecular weight=189.272   }}
+
−
{{#set: common name=prenyl-L-cysteine}}
+
−
{{#set: consumed by=1.8.3.5-RXN}}
+

Revision as of 15:37, 21 March 2018

Gene Tiso_gene_10799

  • right end position:
    • 4919
  • transcription direction:
    • POSITIVE
  • left end position:
    • 3650
  • centisome position:
    • 27.65361
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=GlcA-Gal-Gal-Xyl-Proteins&oldid=35261"