Difference between revisions of "Tiso gene 12896"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-469 CPD-469] == * smiles: ** CC(=O)NC(C([O-])=O)CC[CH]=O * inchi key: ** InChIKey=BCPSFKBPH...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Chlorides Chlorides] == * common name: ** an organochlorine compound * Synonym(s): ** RCl ** an...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-469 CPD-469] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Chlorides Chlorides] ==
−
* smiles:
+
−
** CC(=O)NC(C([O-])=O)CC[CH]=O
+
−
* inchi key:
+
−
** InChIKey=BCPSFKBPHHBDAI-LURJTMIESA-M
+
 
* common name:
 
* common name:
−
** N-acetyl-L-glutamate 5-semialdehyde
+
** an organochlorine compound
−
* molecular weight:
+
−
** 172.16   
+
 
* Synonym(s):
 
* Synonym(s):
−
** N-acetylglutamate γ-semialdehyde
+
** RCl
−
** N-acetyl-L-glutamate-5-semialdehyde
+
** an organic chloride
−
** N-acetyl-L-glutamate semialdehyde
+
−
** N-acetylglutamate semialdehyde
+
−
** 2-acetamido-5-oxopentanoate
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[CHLORIDE-PEROXIDASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[N-ACETYLGLUTPREDUCT-RXN]]
 
−
* [[ACETYLORNTRANSAM-RXN]]
 
 
== External links  ==
 
== External links  ==
−
* METABOLIGHTS : MTBLC29123
+
{{#set: common name=an organochlorine compound}}
−
* PUBCHEM:
+
{{#set: common name=RCl|an organic chloride}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6857435 6857435]
+
{{#set: produced by=CHLORIDE-PEROXIDASE-RXN}}
−
* HMDB : HMDB06488
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C01250 C01250]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.5256773.html 5256773]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29123 29123]
+
−
* BIGG : acg5sa
+
−
{{#set: smiles=CC(=O)NC(C([O-])=O)CC[CH]=O}}
+
−
{{#set: inchi key=InChIKey=BCPSFKBPHHBDAI-LURJTMIESA-M}}
+
−
{{#set: common name=N-acetyl-L-glutamate 5-semialdehyde}}
+
−
{{#set: molecular weight=172.16    }}
+
−
{{#set: common name=N-acetylglutamate γ-semialdehyde|N-acetyl-L-glutamate-5-semialdehyde|N-acetyl-L-glutamate semialdehyde|N-acetylglutamate semialdehyde|2-acetamido-5-oxopentanoate}}
+
−
{{#set: reversible reaction associated=N-ACETYLGLUTPREDUCT-RXN|ACETYLORNTRANSAM-RXN}}
+

Revision as of 15:38, 21 March 2018

Metabolite Chlorides

  • common name:
    • an organochlorine compound
  • Synonym(s):
    • RCl
    • an organic chloride

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_12896&oldid=35362"