Difference between revisions of "Tiso gene 1589"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTOHEME PROTOHEME] == * smiles: ** C=CC1(C(C)=C7(C=C8(C(C)=C(CCC(=O)[O-])C6(=[N+]([Fe--]24(N(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-499 CPD-499] == * smiles: ** CC(O)(CCOP(=O)([O-])[O-])CC(=O)[O-] * common name: ** (R)-meva...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-499 CPD-499] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(O)(CCOP(=O)([O-])[O-])CC(=O)[O-] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** (R)-mevalonate 5-phosphate |
+ | * inchi key: | ||
+ | ** InChIKey=OKZYCXHTTZZYSK-ZCFIWIBFSA-K | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 225.115 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** (R)-5-phosphomevalonic acid |
− | ** | + | ** mevalonate-5P |
+ | ** (R)-5-phosphomevalonate | ||
+ | ** (R)-mevalonic acid 5-phosphate | ||
+ | ** mevalonate-P | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[ | + | * [[MEVALONATE-KINASE-RXN]] |
== External links == | == External links == | ||
+ | * CAS : 73566-35-5 | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244548 25244548] | ||
+ | * HMDB : HMDB01343 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C01107 C01107] | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58146 58146] |
− | * | + | * METABOLIGHTS : MTBLC58146 |
− | {{#set: smiles= | + | {{#set: smiles=CC(O)(CCOP(=O)([O-])[O-])CC(=O)[O-]}} |
− | {{#set: | + | {{#set: common name=(R)-mevalonate 5-phosphate}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=OKZYCXHTTZZYSK-ZCFIWIBFSA-K}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=225.115 }} |
− | {{#set: common name= | + | {{#set: common name=(R)-5-phosphomevalonic acid|mevalonate-5P|(R)-5-phosphomevalonate|(R)-mevalonic acid 5-phosphate|mevalonate-P}} |
− | + | {{#set: reversible reaction associated=MEVALONATE-KINASE-RXN}} | |
− | {{#set: reversible reaction associated= | + |
Revision as of 15:40, 21 March 2018
Contents
Metabolite CPD-499
- smiles:
- CC(O)(CCOP(=O)([O-])[O-])CC(=O)[O-]
- common name:
- (R)-mevalonate 5-phosphate
- inchi key:
- InChIKey=OKZYCXHTTZZYSK-ZCFIWIBFSA-K
- molecular weight:
- 225.115
- Synonym(s):
- (R)-5-phosphomevalonic acid
- mevalonate-5P
- (R)-5-phosphomevalonate
- (R)-mevalonic acid 5-phosphate
- mevalonate-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 73566-35-5
- PUBCHEM:
- HMDB : HMDB01343
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC58146
"CC(O)(CCOP(=O)([O-])[O-])CC(=O)[O-" cannot be used as a page name in this wiki.