Difference between revisions of "RXN-22"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TREHALOSE TREHALOSE] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))O * inchi ke...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11662 RXN-11662] == * direction: ** REVERSIBLE * common name: ** 3-hydroxyacyl-_dehydrogenase *...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11662 RXN-11662] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 3-hydroxyacyl-_dehydrogenase |
− | * | + | ** hydroxyacyl-coenzyme_a_dehydrogenase_3-ketoacyl-coenzyme_a_thiolase_enoyl-coenzyme_a_hydratasealpha_subunit |
− | ** | + | ** hydroxyacyl-coenzyme_a_mitochondrial |
+ | * ec number: | ||
+ | ** [http://enzyme.expasy.org/EC/1.1.1.35 EC-1.1.1.35] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[NAD]][c] '''+''' 1 [[S-3-HYDROXYBUTANOYL-COA]][c] '''<=>''' 1 [[NADH]][c] '''+''' 1 [[ACETOACETYL-COA]][c] '''+''' 1 [[PROTON]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 NAD+[c] '''+''' 1 (S)-3-hydroxybutanoyl-CoA[c] '''<=>''' 1 NADH[c] '''+''' 1 acetoacetyl-CoA[c] '''+''' 1 H+[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_16703]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Gene: [[Tiso_gene_14027]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_14262]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_14026]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_18838]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_18839]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_5857]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | == Pathways == | ||
+ | * [[P162-PWY]], L-glutamate degradation V (via hydroxyglutarate): [http://metacyc.org/META/NEW-IMAGE?object=P162-PWY P162-PWY] | ||
+ | ** '''4''' reactions found over '''11''' reactions in the full pathway | ||
+ | * [[PWY-7216]], (R)- and (S)-3-hydroxybutanoate biosynthesis (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7216 PWY-7216] | ||
+ | ** '''3''' reactions found over '''5''' reactions in the full pathway | ||
+ | * [[CENTFERM-PWY]], pyruvate fermentation to butanoate: [http://metacyc.org/META/NEW-IMAGE?object=CENTFERM-PWY CENTFERM-PWY] | ||
+ | ** '''3''' reactions found over '''7''' reactions in the full pathway | ||
+ | * [[PWY-5177]], glutaryl-CoA degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5177 PWY-5177] | ||
+ | ** '''3''' reactions found over '''5''' reactions in the full pathway | ||
+ | * [[PWY-6583]], pyruvate fermentation to butanol I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6583 PWY-6583] | ||
+ | ** '''4''' reactions found over '''8''' reactions in the full pathway | ||
+ | * [[PWY-6883]], pyruvate fermentation to butanol II (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6883 PWY-6883] | ||
+ | ** '''4''' reactions found over '''6''' reactions in the full pathway | ||
+ | * [[PWY-7401]], crotonate fermentation (to acetate and cyclohexane carboxylate): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7401 PWY-7401] | ||
+ | ** '''5''' reactions found over '''17''' reactions in the full pathway | ||
+ | * [[PWY-7778]], 2-methylpropene degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7778 PWY-7778] | ||
+ | ** '''2''' reactions found over '''8''' reactions in the full pathway | ||
+ | * [[PWY-7779]], methyl tert-butyl ether degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7779 PWY-7779] | ||
+ | ** '''2''' reactions found over '''10''' reactions in the full pathway | ||
+ | * [[PWY-5789]], 3-hydroxypropanoate/4-hydroxybutanate cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5789 PWY-5789] | ||
+ | ** '''8''' reactions found over '''16''' reactions in the full pathway | ||
+ | * [[PWY-6863]], pyruvate fermentation to hexanol (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6863 PWY-6863] | ||
+ | ** '''5''' reactions found over '''11''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30799 30799] | |
− | + | * LIGAND-RXN: | |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01975 R01975] |
− | + | {{#set: direction=REVERSIBLE}} | |
− | + | {{#set: common name=3-hydroxyacyl-_dehydrogenase}} | |
− | * LIGAND- | + | {{#set: common name=hydroxyacyl-coenzyme_a_dehydrogenase_3-ketoacyl-coenzyme_a_thiolase_enoyl-coenzyme_a_hydratasealpha_subunit}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: common name=hydroxyacyl-coenzyme_a_mitochondrial}} |
− | + | {{#set: ec number=EC-1.1.1.35}} | |
− | + | {{#set: gene associated=Tiso_gene_16703|Tiso_gene_14027|Tiso_gene_14262|Tiso_gene_14026|Tiso_gene_18838|Tiso_gene_18839|Tiso_gene_5857}} | |
− | + | {{#set: in pathway=P162-PWY|PWY-7216|CENTFERM-PWY|PWY-5177|PWY-6583|PWY-6883|PWY-7401|PWY-7778|PWY-7779|PWY-5789|PWY-6863}} | |
− | + | {{#set: reconstruction category=orthology|annotation}} | |
− | + | {{#set: reconstruction source=orthology-creinhardtii|annotation-experimental_annotation|orthology-athaliana|annotation-in-silico_annotation|orthology-esiliculosus}} | |
− | {{#set: | + | {{#set: reconstruction tool=pantograph|pathwaytools}} |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 16:40, 21 March 2018
Contents
Reaction RXN-11662
- direction:
- REVERSIBLE
- common name:
- 3-hydroxyacyl-_dehydrogenase
- hydroxyacyl-coenzyme_a_dehydrogenase_3-ketoacyl-coenzyme_a_thiolase_enoyl-coenzyme_a_hydratasealpha_subunit
- hydroxyacyl-coenzyme_a_mitochondrial
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 NAD[c] + 1 S-3-HYDROXYBUTANOYL-COA[c] <=> 1 NADH[c] + 1 ACETOACETYL-COA[c] + 1 PROTON[c]
- With common name(s):
- 1 NAD+[c] + 1 (S)-3-hydroxybutanoyl-CoA[c] <=> 1 NADH[c] + 1 acetoacetyl-CoA[c] + 1 H+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_16703
- Source: orthology-creinhardtii
- Gene: Tiso_gene_14027
- Source: orthology-esiliculosus
- Gene: Tiso_gene_14262
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_14026
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_18838
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_18839
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_5857
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: orthology-athaliana
- Source: orthology-esiliculosus
- Source: orthology-creinhardtii
- Source: orthology-creinhardtii
- Source: annotation-in-silico_annotation
Pathways
- P162-PWY, L-glutamate degradation V (via hydroxyglutarate): P162-PWY
- 4 reactions found over 11 reactions in the full pathway
- PWY-7216, (R)- and (S)-3-hydroxybutanoate biosynthesis (engineered): PWY-7216
- 3 reactions found over 5 reactions in the full pathway
- CENTFERM-PWY, pyruvate fermentation to butanoate: CENTFERM-PWY
- 3 reactions found over 7 reactions in the full pathway
- PWY-5177, glutaryl-CoA degradation: PWY-5177
- 3 reactions found over 5 reactions in the full pathway
- PWY-6583, pyruvate fermentation to butanol I: PWY-6583
- 4 reactions found over 8 reactions in the full pathway
- PWY-6883, pyruvate fermentation to butanol II (engineered): PWY-6883
- 4 reactions found over 6 reactions in the full pathway
- PWY-7401, crotonate fermentation (to acetate and cyclohexane carboxylate): PWY-7401
- 5 reactions found over 17 reactions in the full pathway
- PWY-7778, 2-methylpropene degradation: PWY-7778
- 2 reactions found over 8 reactions in the full pathway
- PWY-7779, methyl tert-butyl ether degradation: PWY-7779
- 2 reactions found over 10 reactions in the full pathway
- PWY-5789, 3-hydroxypropanoate/4-hydroxybutanate cycle: PWY-5789
- 8 reactions found over 16 reactions in the full pathway
- PWY-6863, pyruvate fermentation to hexanol (engineered): PWY-6863
- 5 reactions found over 11 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-athaliana
- Tool: pantograph
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-athaliana
- Category: annotation
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
External links