Difference between revisions of "CPD0-1162"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_5392 == * Synonym(s): == Reactions associated == * FADSYN-RXN ** pantograph-creinhardtii == Pathways associated == * PWY66-3...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BETA-D-XYLOSE BETA-D-XYLOSE] == * smiles: ** C1(OC(O)C(O)C(O)C(O)1) * common name: ** β-D-...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BETA-D-XYLOSE BETA-D-XYLOSE] == |
+ | * smiles: | ||
+ | ** C1(OC(O)C(O)C(O)C(O)1) | ||
+ | * common name: | ||
+ | ** β-D-xylopyranose | ||
+ | * inchi key: | ||
+ | ** InChIKey=SRBFZHDQGSBBOR-KKQCNMDGSA-N | ||
+ | * molecular weight: | ||
+ | ** 150.131 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** β-D-xylose | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[3.2.1.37-RXN]] | |
− | == | + | == Reaction(s) of unknown directionality == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=125409 125409] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.111589.html 111589] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28161 28161] | ||
+ | * METABOLIGHTS : MTBLC28161 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C02096 C02096] | ||
+ | {{#set: smiles=C1(OC(O)C(O)C(O)C(O)1)}} | ||
+ | {{#set: common name=β-D-xylopyranose}} | ||
+ | {{#set: inchi key=InChIKey=SRBFZHDQGSBBOR-KKQCNMDGSA-N}} | ||
+ | {{#set: molecular weight=150.131 }} | ||
+ | {{#set: common name=β-D-xylose}} | ||
+ | {{#set: produced by=3.2.1.37-RXN}} |
Revision as of 15:40, 21 March 2018
Contents
Metabolite BETA-D-XYLOSE
- smiles:
- C1(OC(O)C(O)C(O)C(O)1)
- common name:
- β-D-xylopyranose
- inchi key:
- InChIKey=SRBFZHDQGSBBOR-KKQCNMDGSA-N
- molecular weight:
- 150.131
- Synonym(s):
- β-D-xylose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links