Difference between revisions of "2-Hydroxy-carboxylates"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PROLINE-RACEMASE-RXN PROLINE-RACEMASE-RXN] == * direction: ** REVERSIBLE * common name: ** proline_...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTOHEME PROTOHEME] == * smiles: ** C=CC1(C(C)=C7(C=C8(C(C)=C(CCC(=O)[O-])C6(=[N+]([Fe--]24(N(...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=PROLINE-RACEMASE-RXN PROLINE-RACEMASE-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTOHEME PROTOHEME] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C=CC1(C(C)=C7(C=C8(C(C)=C(CCC(=O)[O-])C6(=[N+]([Fe--]24(N(C=1C=C3(C(C)=C(C=C)C(=[N+]23)C=C5(C(C)=C(CCC(=O)[O-])C(N45)=C6)))7))8))))
 
* common name:
 
* common name:
−
** proline_racemase
+
** ferroheme b
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/5.1.1.4 EC-5.1.1.4]
+
** InChIKey=KABFMIBPWCXCRK-RGGAHWMASA-J
 +
* molecular weight:
 +
** 614.482   
 
* Synonym(s):
 
* Synonym(s):
 +
** protoheme IX
 +
** ferroprotoporphyrin IX
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[HEME-OXYGENASE-DECYCLIZING-RXN]]
−
** 1 [[PRO]][c] '''<=>''' 1 [[D-PROLINE]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 L-proline[c] '''<=>''' 1 D-proline[c]
+
* [[PROTOHEMEFERROCHELAT-RXN]]
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_13061]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-6344]], L-ornithine degradation II (Stickland reaction): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6344 PWY-6344]
+
−
** '''4''' reactions found over '''9''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* CHEBI:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10680 10680]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17627 17627]
−
* LIGAND-RXN:
+
* BIGG : pheme
−
** [http://www.genome.jp/dbget-bin/www_bget?R01255 R01255]
+
{{#set: smiles=C=CC1(C(C)=C7(C=C8(C(C)=C(CCC(=O)[O-])C6(=[N+]([Fe--]24(N(C=1C=C3(C(C)=C(C=C)C(=[N+]23)C=C5(C(C)=C(CCC(=O)[O-])C(N45)=C6)))7))8))))}}
−
{{#set: direction=REVERSIBLE}}
+
{{#set: common name=ferroheme b}}
−
{{#set: common name=proline_racemase}}
+
{{#set: inchi key=InChIKey=KABFMIBPWCXCRK-RGGAHWMASA-J}}
−
{{#set: ec number=EC-5.1.1.4}}
+
{{#set: molecular weight=614.482    }}
−
{{#set: gene associated=Tiso_gene_13061}}
+
{{#set: common name=protoheme IX|ferroprotoporphyrin IX}}
−
{{#set: in pathway=PWY-6344}}
+
{{#set: consumed by=HEME-OXYGENASE-DECYCLIZING-RXN}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: reversible reaction associated=PROTOHEMEFERROCHELAT-RXN}}
−
{{#set: reconstruction source=annotation-in-silico_annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+

Revision as of 16:41, 21 March 2018

Metabolite PROTOHEME

  • smiles:
    • C=CC1(C(C)=C7(C=C8(C(C)=C(CCC(=O)[O-])C6(=[N+]([Fe--]24(N(C=1C=C3(C(C)=C(C=C)C(=[N+]23)C=C5(C(C)=C(CCC(=O)[O-])C(N45)=C6)))7))8))))
  • common name:
    • ferroheme b
  • inchi key:
    • InChIKey=KABFMIBPWCXCRK-RGGAHWMASA-J
  • molecular weight:
    • 614.482
  • Synonym(s):
    • protoheme IX
    • ferroprotoporphyrin IX

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • CHEBI:
  • BIGG : pheme
"C=CC1(C(C)=C7(C=C8(C(C)=C(CCC(=O)[O-])C6(=[N+]([Fe--]24(N(C=1C=C3(C(C)=C(C=C)C(=[N+]23)C=C5(C(C)=C(CCC(=O)[O-])C(N45)=C6)))7))8))))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=2-Hydroxy-carboxylates&oldid=35600"