Difference between revisions of "Tiso gene 15143"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_7102 == * Synonym(s): == Reactions associated == * GLUC1PURIDYLTRANS-RXN ** pantograph-esiliculosus == Pathways associated ==...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17402 CPD-17402] == * smiles: ** CCC=CCCC(O)CC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17402 CPD-17402] == |
| + | * smiles: | ||
| + | ** CCC=CCCC(O)CC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ||
| + | * common name: | ||
| + | ** (3R)-hydroxy-auricoloyl-CoA | ||
| + | * inchi key: | ||
| + | ** InChIKey=XTSCLYCOOJHTTR-KTFRUSDTSA-J | ||
| + | * molecular weight: | ||
| + | ** 1085.989 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** (3R)-hydroxy-(11Z,17Z)-14R-hydroxy-icosa-11,17-dienoyl-CoA | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-16154]] | |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820222 91820222] |
| + | {{#set: smiles=CCC=CCCC(O)CC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
| + | {{#set: common name=(3R)-hydroxy-auricoloyl-CoA}} | ||
| + | {{#set: inchi key=InChIKey=XTSCLYCOOJHTTR-KTFRUSDTSA-J}} | ||
| + | {{#set: molecular weight=1085.989 }} | ||
| + | {{#set: common name=(3R)-hydroxy-(11Z,17Z)-14R-hydroxy-icosa-11,17-dienoyl-CoA}} | ||
| + | {{#set: produced by=RXN-16154}} | ||
Revision as of 16:42, 21 March 2018
Contents
Metabolite CPD-17402
- smiles:
- CCC=CCCC(O)CC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- common name:
- (3R)-hydroxy-auricoloyl-CoA
- inchi key:
- InChIKey=XTSCLYCOOJHTTR-KTFRUSDTSA-J
- molecular weight:
- 1085.989
- Synonym(s):
- (3R)-hydroxy-(11Z,17Z)-14R-hydroxy-icosa-11,17-dienoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCC=CCCC(O)CC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
