Difference between revisions of "CPD-9925"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-MANNOSE GDP-MANNOSE] == * smiles: ** C(OP([O-])(=O)OP([O-])(=O)OC1(OC(C(O)C(O)C(O)1)CO))C2(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R01220 R01220] == * direction: ** REVERSIBLE * common name: ** R146 * Synonym(s): == Reaction Form...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-MANNOSE GDP-MANNOSE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=R01220 R01220] ==
* smiles:
+
* direction:
** C(OP([O-])(=O)OP([O-])(=O)OC1(OC(C(O)C(O)C(O)1)CO))C2(C(O)C(O)C(O2)N4(C=NC3(C(=O)NC(N)=NC=34)))
+
** REVERSIBLE
* inchi key:
+
** InChIKey=MVMSCBBUIHUTGJ-GDJBGNAASA-L
+
 
* common name:
 
* common name:
** GDP-α-D-mannose
+
** R146
* molecular weight:
+
** 603.329   
+
 
* Synonym(s):
 
* Synonym(s):
** guanosine pyrophosphate mannose
 
** guanosine diphosphomannose
 
** guanosine diphosphate mannose
 
** GDP-mannose
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-5464]]
+
* With identifiers:
* [[GDPMANDEHYDRA-RXN]]
+
** 1.0 [[NADP]][c] '''+''' 1.0 [[METHYLENE-THF]][c] '''<=>''' 1.0 [[NADPH]][c] '''+''' 1.0 [[5-10-METHENYL-THF]][c]
* [[RXN-5462]]
+
* With common name(s):
* [[RXN-5463]]
+
** 1.0 NADP+[c] '''+''' 1.0 5,10-methylenetetrahydropteroyl mono-L-glutamate[c] '''<=>''' 1.0 NADPH[c] '''+''' 1.0 5,10-methenyltetrahydrofolate mono-L-glutamate[c]
* [[2.4.1.83-RXN]]
+
 
* [[2.4.1.142-RXN]]
+
== Genes associated with this reaction  ==
* [[RXN-16602]]
+
Genes have been associated with this reaction based on different elements listed below.
== Reaction(s) known to produce the compound ==
+
* Gene: [[Tiso_gene_432]]
* [[2.7.7.13-RXN]]
+
** Source: [[orthology-synechocystis]]
* [[GAMPG]]
+
== Pathways  ==
== Reaction(s) of unknown directionality ==
+
== Reconstruction information  ==
* [[2.4.1.232-RXN]]
+
* Category: [[orthology]]
* [[2.4.1.32-RXN]]
+
** Source: [[orthology-synechocystis]]
* [[RXN-1882]]
+
*** Tool: [[pantograph]]
* [[RXN-7771]]
+
* [[MANNPGUANYLTRANGDP-RXN]]
+
 
== External links  ==
 
== External links  ==
* CAS : 18441-12-8
+
{{#set: direction=REVERSIBLE}}
* CAS : 3123-67-9
+
{{#set: common name=R146}}
* METABOLIGHTS : MTBLC57527
+
{{#set: gene associated=Tiso_gene_432}}
* PUBCHEM:
+
{{#set: in pathway=}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878389 46878389]
+
{{#set: reconstruction category=orthology}}
* HMDB : HMDB01163
+
{{#set: reconstruction source=orthology-synechocystis}}
* LIGAND-CPD:
+
{{#set: reconstruction tool=pantograph}}
** [http://www.genome.jp/dbget-bin/www_bget?C00096 C00096]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57527 57527]
+
* BIGG : gdpmann
+
{{#set: smiles=C(OP([O-])(=O)OP([O-])(=O)OC1(OC(C(O)C(O)C(O)1)CO))C2(C(O)C(O)C(O2)N4(C=NC3(C(=O)NC(N)=NC=34)))}}
+
{{#set: inchi key=InChIKey=MVMSCBBUIHUTGJ-GDJBGNAASA-L}}
+
{{#set: common name=GDP-&alpha;-D-mannose}}
+
{{#set: molecular weight=603.329    }}
+
{{#set: common name=guanosine pyrophosphate mannose|guanosine diphosphomannose|guanosine diphosphate mannose|GDP-mannose}}
+
{{#set: consumed by=RXN-5464|GDPMANDEHYDRA-RXN|RXN-5462|RXN-5463|2.4.1.83-RXN|2.4.1.142-RXN|RXN-16602}}
+
{{#set: produced by=2.7.7.13-RXN|GAMPG}}
+
{{#set: reversible reaction associated=2.4.1.232-RXN|2.4.1.32-RXN|RXN-1882|RXN-7771|MANNPGUANYLTRANGDP-RXN}}
+

Revision as of 15:42, 21 March 2018

Reaction R01220

  • direction:
    • REVERSIBLE
  • common name:
    • R146
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 NADP+[c] + 1.0 5,10-methylenetetrahydropteroyl mono-L-glutamate[c] <=> 1.0 NADPH[c] + 1.0 5,10-methenyltetrahydrofolate mono-L-glutamate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links