Difference between revisions of "RXN-5471"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_19590 == * left end position: ** 25 * transcription direction: ** POSITIVE * right end position: ** 2169 * centisome position: ** 1.1379154...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIMETHYL-D-RIBITYL-LUMAZINE DIMETHYL-D-RIBITYL-LUMAZINE] == * smiles: ** CC2(=C(C)N(CC(O)C(O)C(...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIMETHYL-D-RIBITYL-LUMAZINE DIMETHYL-D-RIBITYL-LUMAZINE] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC2(=C(C)N(CC(O)C(O)C(O)CO)C1(C(C(=O)[N-]C(=O)N=1)=N2)) |
| − | * | + | * common name: |
| − | ** | + | ** 6,7-dimethyl-8-(1-D-ribityl)lumazine |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=SXDXRJZUAJBNFL-XKSSXDPKSA-M |
| − | * | + | * molecular weight: |
| − | ** | + | ** 325.3 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RIBOFLAVIN-SYN-RXN]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * LIGAND-CPD: | |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04332 C04332] |
| − | {{#set: | + | * HMDB : HMDB03826 |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58201 58201] |
| − | {{#set: | + | * BIGG : dmlz |
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46931117 46931117] | ||
| + | {{#set: smiles=CC2(=C(C)N(CC(O)C(O)C(O)CO)C1(C(C(=O)[N-]C(=O)N=1)=N2))}} | ||
| + | {{#set: common name=6,7-dimethyl-8-(1-D-ribityl)lumazine}} | ||
| + | {{#set: inchi key=InChIKey=SXDXRJZUAJBNFL-XKSSXDPKSA-M}} | ||
| + | {{#set: molecular weight=325.3 }} | ||
| + | {{#set: consumed by=RIBOFLAVIN-SYN-RXN}} | ||
Revision as of 15:43, 21 March 2018
Contents
Metabolite DIMETHYL-D-RIBITYL-LUMAZINE
- smiles:
- CC2(=C(C)N(CC(O)C(O)C(O)CO)C1(C(C(=O)[N-]C(=O)N=1)=N2))
- common name:
- 6,7-dimethyl-8-(1-D-ribityl)lumazine
- inchi key:
- InChIKey=SXDXRJZUAJBNFL-XKSSXDPKSA-M
- molecular weight:
- 325.3
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC2(=C(C)N(CC(O)C(O)C(O)CO)C1(C(C(=O)[N-]C(=O)N=1)=N2))" cannot be used as a page name in this wiki.
